1-[11-hydroxy-7-(4-hydroxy-3-methoxyphenyl)-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2-oxa-8-oxoniatricyclo[7.3.1.05,13]trideca-1(12),3,5,7,9(13),10-hexaen-3-yl]ethanone
Internal ID | b3cbaac2-226b-49af-a417-ec1f84833bc5 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Anthocyanins > Anthocyanidin-3-O-glycosides |
IUPAC Name | 1-[11-hydroxy-7-(4-hydroxy-3-methoxyphenyl)-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2-oxa-8-oxoniatricyclo[7.3.1.05,13]trideca-1(12),3,5,7,9(13),10-hexaen-3-yl]ethanone |
SMILES (Canonical) | CC(=O)C1=CC2=C(C(=[O+]C3=C2C(=CC(=C3)O)O1)C4=CC(=C(C=C4)O)OC)OC5C(C(C(C(O5)CO)O)O)O |
SMILES (Isomeric) | CC(=O)C1=CC2=C(C(=[O+]C3=C2C(=CC(=C3)O)O1)C4=CC(=C(C=C4)O)OC)O[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)CO)O)O)O |
InChI | InChI=1S/C26H24O12/c1-10(28)15-8-13-20-17(35-15)6-12(29)7-18(20)36-24(11-3-4-14(30)16(5-11)34-2)25(13)38-26-23(33)22(32)21(31)19(9-27)37-26/h3-8,19,21-23,26-27,31-33H,9H2,1-2H3,(H-,29,30)/p+1/t19-,21-,22+,23-,26+/m1/s1 |
InChI Key | FMUIDSFQRPFABV-YRHADEBDSA-O |
Popularity | 0 references in papers |
Molecular Formula | C26H25O12+ |
Molecular Weight | 529.50 g/mol |
Exact Mass | 529.13460123 g/mol |
Topological Polar Surface Area (TPSA) | 176.00 Ų |
XlogP | 0.00 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.81% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.11% | 91.11% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 97.01% | 94.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.24% | 94.45% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 95.12% | 99.17% |
CHEMBL220 | P22303 | Acetylcholinesterase | 94.01% | 94.45% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.24% | 89.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.12% | 85.14% |
CHEMBL2581 | P07339 | Cathepsin D | 92.66% | 98.95% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 90.87% | 99.15% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.46% | 86.33% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 87.76% | 95.50% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 87.26% | 95.78% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 86.93% | 86.92% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 84.26% | 96.95% |
CHEMBL1287628 | Q9Y5S8 | NADPH oxidase 1 | 84.03% | 95.48% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 83.95% | 94.33% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.85% | 95.89% |
CHEMBL3401 | O75469 | Pregnane X receptor | 83.64% | 94.73% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 83.17% | 96.21% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.24% | 97.09% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.23% | 96.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.53% | 95.89% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.26% | 95.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.