(8-hydroxy-5,8a-dimethyl-3-propan-2-yl-2,3,4,4a,7,8-hexahydro-1H-naphthalen-1-yl) 3-phenylprop-2-enoate
Internal ID | 0a17115a-0549-450e-b1e7-3c3736ecfd58 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids > Eudesmane, isoeudesmane or cycloeudesmane sesquiterpenoids |
IUPAC Name | (8-hydroxy-5,8a-dimethyl-3-propan-2-yl-2,3,4,4a,7,8-hexahydro-1H-naphthalen-1-yl) 3-phenylprop-2-enoate |
SMILES (Canonical) | CC1=CCC(C2(C1CC(CC2OC(=O)C=CC3=CC=CC=C3)C(C)C)C)O |
SMILES (Isomeric) | CC1=CCC(C2(C1CC(CC2OC(=O)C=CC3=CC=CC=C3)C(C)C)C)O |
InChI | InChI=1S/C24H32O3/c1-16(2)19-14-20-17(3)10-12-21(25)24(20,4)22(15-19)27-23(26)13-11-18-8-6-5-7-9-18/h5-11,13,16,19-22,25H,12,14-15H2,1-4H3 |
InChI Key | DNSYTDAEXWUCHW-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C24H32O3 |
Molecular Weight | 368.50 g/mol |
Exact Mass | 368.23514488 g/mol |
Topological Polar Surface Area (TPSA) | 46.50 Ų |
XlogP | 5.40 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.09% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.96% | 86.33% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.59% | 91.11% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 94.28% | 90.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.77% | 96.09% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 92.27% | 96.00% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 91.83% | 95.50% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 88.96% | 94.62% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 88.46% | 94.08% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 87.97% | 93.56% |
CHEMBL2581 | P07339 | Cathepsin D | 87.88% | 98.95% |
CHEMBL5028 | O14672 | ADAM10 | 87.16% | 97.50% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 86.09% | 97.21% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.69% | 97.09% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 82.49% | 91.07% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 82.03% | 93.99% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 81.85% | 96.47% |
CHEMBL4208 | P20618 | Proteasome component C5 | 81.52% | 90.00% |
CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 81.43% | 94.23% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 81.16% | 96.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.94% | 89.00% |
CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 80.58% | 89.67% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Solidago nemoralis |
PubChem | 162885313 |
LOTUS | LTS0203781 |
wikiData | Q104985730 |