(2R,3R,4S,5S,6R)-2-[[(3S,8S,9S,10R,13S,14S,17R)-17-[(2S,3S)-3,7-dihydroxy-6-methylheptan-2-yl]-16-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol
Internal ID | fba0ce4d-9b4c-4447-9212-adbadfb0c935 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides |
IUPAC Name | (2R,3R,4S,5S,6R)-2-[[(3S,8S,9S,10R,13S,14S,17R)-17-[(2S,3S)-3,7-dihydroxy-6-methylheptan-2-yl]-16-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
SMILES (Canonical) | CC(CCC(C(C)C1C(CC2C1(CCC3C2CC=C4C3(CCC(C4)OC5C(C(C(C(O5)CO)O)O)O)C)C)O)O)CO |
SMILES (Isomeric) | C[C@@H]([C@H]1C(C[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC=C4[C@@]3(CC[C@@H](C4)O[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)CO)O)O)O)C)C)O)[C@H](CCC(C)CO)O |
InChI | InChI=1S/C33H56O9/c1-17(15-34)5-8-24(36)18(2)27-25(37)14-23-21-7-6-19-13-20(9-11-32(19,3)22(21)10-12-33(23,27)4)41-31-30(40)29(39)28(38)26(16-35)42-31/h6,17-18,20-31,34-40H,5,7-16H2,1-4H3/t17?,18-,20+,21-,22+,23+,24+,25?,26-,27+,28-,29+,30-,31-,32+,33+/m1/s1 |
InChI Key | CIJMRXVIZACOJX-JNRDSNHMSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C33H56O9 |
Molecular Weight | 596.80 g/mol |
Exact Mass | 596.39243336 g/mol |
Topological Polar Surface Area (TPSA) | 160.00 Ų |
XlogP | 2.90 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.37% | 96.09% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 98.06% | 95.93% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.56% | 97.25% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.44% | 91.11% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 96.11% | 97.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.71% | 85.14% |
CHEMBL2581 | P07339 | Cathepsin D | 93.93% | 98.95% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 90.86% | 100.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 88.76% | 95.89% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 88.51% | 97.79% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.18% | 95.89% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.61% | 94.45% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.54% | 89.00% |
CHEMBL2094135 | Q96BI3 | Gamma-secretase | 87.54% | 98.05% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 86.50% | 93.56% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 85.60% | 89.05% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 85.47% | 100.00% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 85.30% | 100.00% |
CHEMBL237 | P41145 | Kappa opioid receptor | 84.64% | 98.10% |
CHEMBL3401 | O75469 | Pregnane X receptor | 83.67% | 94.73% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 82.05% | 94.08% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Trillium erectum |
PubChem | 102283898 |
LOTUS | LTS0210703 |
wikiData | Q104959872 |