4-Hydroxy-15-methoxy-10-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),2(7),3,5,8,12(16),13-heptaen-11-one
| Internal ID | 073bdc40-aaf2-4071-92fb-2b8f3c29f167 |
| Taxonomy | Benzenoids > Phenanthrenes and derivatives > Phenanthrols |
| IUPAC Name | 4-hydroxy-15-methoxy-10-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),2(7),3,5,8,12(16),13-heptaen-11-one |
| SMILES (Canonical) | COC1=C2C3=C(C=CC(=C3)O)C=C4C2=C(C=C1)C(=O)N4 |
| SMILES (Isomeric) | COC1=C2C3=C(C=CC(=C3)O)C=C4C2=C(C=C1)C(=O)N4 |
| InChI | InChI=1S/C16H11NO3/c1-20-13-5-4-10-14-12(17-16(10)19)6-8-2-3-9(18)7-11(8)15(13)14/h2-7,18H,1H3,(H,17,19) |
| InChI Key | ZKXBFLQGGFVSGB-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C16H11NO3 |
| Molecular Weight | 265.26 g/mol |
| Exact Mass | 265.07389321 g/mol |
| Topological Polar Surface Area (TPSA) | 58.60 Ų |
| XlogP | 3.00 |
| There are no found synonyms. |
![2D Structure of 4-Hydroxy-15-methoxy-10-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),2(7),3,5,8,12(16),13-heptaen-11-one](https://plantaedb.com/storage/docs/compounds/2023/11/cd7731d0-867c-11ee-aa6a-2555666eccaf.jpg "2D Structure of 4-Hydroxy-15-methoxy-10-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),2(7),3,5,8,12(16),13-heptaen-11-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.39% | 91.11% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 95.87% | 94.75% |
| CHEMBL2535 | P11166 | Glucose transporter | 94.15% | 98.75% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.82% | 98.95% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 93.81% | 90.20% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.47% | 94.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.80% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.64% | 86.33% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 91.18% | 89.62% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.86% | 96.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.45% | 94.45% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 86.75% | 98.35% |
| CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 85.05% | 96.09% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 84.73% | 90.00% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 83.83% | 93.31% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 83.32% | 95.56% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 83.27% | 93.03% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.03% | 90.71% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.82% | 99.23% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 82.63% | 92.94% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.04% | 95.89% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 81.37% | 91.49% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 80.97% | 96.67% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.77% | 89.00% |
| CHEMBL4145 | Q9UKV0 | Histone deacetylase 9 | 80.04% | 85.49% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.02% | 99.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Fissistigma oldhamii |
| Goniothalamus borneensis |
| PubChem | 162963657 |
| LOTUS | LTS0046542 |
| wikiData | Q105378786 |