[3,3,7,9-Tetramethyl-6-(3-methylbutanoyloxy)-11-oxo-4-tricyclo[5.4.0.02,8]undec-9-enyl] 2-methylbut-2-enoate
Internal ID | 092b48c4-036f-47de-a03e-7cc7cc17c2b4 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Monoterpenoids > Bicyclic monoterpenoids |
IUPAC Name | [3,3,7,9-tetramethyl-6-(3-methylbutanoyloxy)-11-oxo-4-tricyclo[5.4.0.02,8]undec-9-enyl] 2-methylbut-2-enoate |
SMILES (Canonical) | CC=C(C)C(=O)OC1CC(C2(C3C(C2C(=O)C=C3C)C1(C)C)C)OC(=O)CC(C)C |
SMILES (Isomeric) | CC=C(C)C(=O)OC1CC(C2(C3C(C2C(=O)C=C3C)C1(C)C)C)OC(=O)CC(C)C |
InChI | InChI=1S/C25H36O5/c1-9-14(4)23(28)30-17-12-18(29-19(27)10-13(2)3)25(8)20-15(5)11-16(26)21(25)22(20)24(17,6)7/h9,11,13,17-18,20-22H,10,12H2,1-8H3 |
InChI Key | SCDIIKOGQOUENK-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C25H36O5 |
Molecular Weight | 416.50 g/mol |
Exact Mass | 416.25627424 g/mol |
Topological Polar Surface Area (TPSA) | 69.70 Ų |
XlogP | 4.70 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 96.32% | 97.21% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.28% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.85% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 93.99% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.08% | 95.56% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 92.03% | 96.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.57% | 94.45% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.72% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.69% | 86.33% |
CHEMBL3975 | P09467 | Fructose-1,6-bisphosphatase | 86.24% | 92.95% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.50% | 99.23% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 84.29% | 97.79% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.74% | 97.09% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 83.44% | 91.07% |
CHEMBL4208 | P20618 | Proteasome component C5 | 82.21% | 90.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.12% | 91.19% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 80.40% | 94.75% |
CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 80.01% | 90.93% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Stevia salicifolia |
PubChem | 74155499 |
LOTUS | LTS0206569 |
wikiData | Q105250042 |