[(1S,4aS,6S,7S,7aS)-4-[[(2R,3R,4S,5R,6R)-4-acetyloxy-3,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-6-hydroxy-7-(hydroxymethyl)-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-1-yl] 3-methylbutanoate
Internal ID | 9fdfee9b-f587-4c15-9580-f5c79c004823 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides |
IUPAC Name | [(1S,4aS,6S,7S,7aS)-4-[[(2R,3R,4S,5R,6R)-4-acetyloxy-3,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-6-hydroxy-7-(hydroxymethyl)-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-1-yl] 3-methylbutanoate |
SMILES (Canonical) | CC(C)CC(=O)OC1C2C(CC(C2CO)O)C(=CO1)COC3C(C(C(C(O3)CO)O)OC(=O)C)O |
SMILES (Isomeric) | CC(C)CC(=O)O[C@H]1[C@H]2[C@H](C[C@@H]([C@@H]2CO)O)C(=CO1)CO[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)OC(=O)C)O |
InChI | InChI=1S/C23H36O12/c1-10(2)4-17(28)35-22-18-13(5-15(27)14(18)6-24)12(8-31-22)9-32-23-20(30)21(33-11(3)26)19(29)16(7-25)34-23/h8,10,13-16,18-25,27,29-30H,4-7,9H2,1-3H3/t13-,14+,15+,16-,18+,19-,20-,21+,22+,23-/m1/s1 |
InChI Key | MBEMEMCYVGQECK-CJUAORSWSA-N |
Popularity | 0 references in papers |
Molecular Formula | C23H36O12 |
Molecular Weight | 504.50 g/mol |
Exact Mass | 504.22067658 g/mol |
Topological Polar Surface Area (TPSA) | 181.00 Ų |
XlogP | -0.60 |
There are no found synonyms. |
![2D Structure of [(1S,4aS,6S,7S,7aS)-4-[[(2R,3R,4S,5R,6R)-4-acetyloxy-3,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-6-hydroxy-7-(hydroxymethyl)-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-1-yl] 3-methylbutanoate 2D Structure of [(1S,4aS,6S,7S,7aS)-4-[[(2R,3R,4S,5R,6R)-4-acetyloxy-3,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-6-hydroxy-7-(hydroxymethyl)-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-1-yl] 3-methylbutanoate](https://plantaedb.com/storage/docs/compounds/2023/11/ccf701c0-87a4-11ee-bcfb-21b2dc497117.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.59% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.51% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 94.64% | 98.95% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 94.63% | 95.93% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.35% | 97.09% |
CHEMBL3401 | O75469 | Pregnane X receptor | 88.93% | 94.73% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.33% | 89.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.32% | 99.17% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 86.71% | 86.92% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 86.14% | 95.89% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.65% | 94.45% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 85.60% | 97.21% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 84.54% | 85.14% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.80% | 96.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.39% | 91.19% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 82.96% | 92.50% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 81.73% | 89.50% |
CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 81.39% | 82.50% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.40% | 95.56% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.05% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Viburnum lantana |
PubChem | 162868021 |
LOTUS | LTS0124412 |
wikiData | Q105160694 |