7-[(2S,3R,4R,5S,6S)-3,5-dihydroxy-6-methyl-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-5-hydroxy-2-(4-hydroxyphenyl)-3-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-[[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxychromen-4-one
Internal ID | 9e37b11e-1b2e-4e66-9a04-91855eee674a |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-7-O-glycosides |
IUPAC Name | 7-[(2S,3R,4R,5S,6S)-3,5-dihydroxy-6-methyl-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-5-hydroxy-2-(4-hydroxyphenyl)-3-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-[[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxychromen-4-one |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2=CC(=C3C(=C2)OC(=C(C3=O)OC4C(C(C(C(O4)COC5C(C(C(C(O5)CO)O)O)O)O)O)O)C6=CC=C(C=C6)O)O)O)OC7C(C(C(C(O7)CO)O)O)O)O |
SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)OC2=CC(=C3C(=C2)OC(=C(C3=O)O[C@H]4[C@@H]([C@H]([C@H]([C@H](O4)CO[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)CO)O)O)O)O)O)O)C6=CC=C(C=C6)O)O)O)O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO)O)O)O)O |
InChI | InChI=1S/C39H50O25/c1-11-21(44)34(63-37-30(53)27(50)23(46)18(9-41)61-37)32(55)39(57-11)58-14-6-15(43)20-16(7-14)59-33(12-2-4-13(42)5-3-12)35(25(20)48)64-38-31(54)28(51)24(47)19(62-38)10-56-36-29(52)26(49)22(45)17(8-40)60-36/h2-7,11,17-19,21-24,26-32,34,36-47,49-55H,8-10H2,1H3/t11-,17+,18+,19+,21-,22+,23+,24-,26-,27-,28-,29+,30+,31+,32+,34+,36+,37-,38-,39-/m0/s1 |
InChI Key | FOQDUKUEWRKMCX-ZBVLFGNGSA-N |
Popularity | 0 references in papers |
Molecular Formula | C39H50O25 |
Molecular Weight | 918.80 g/mol |
Exact Mass | 918.26411708 g/mol |
Topological Polar Surface Area (TPSA) | 404.00 Ų |
XlogP | -4.30 |
There are no found synonyms. |
![2D Structure of 7-[(2S,3R,4R,5S,6S)-3,5-dihydroxy-6-methyl-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-5-hydroxy-2-(4-hydroxyphenyl)-3-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-[[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxychromen-4-one 2D Structure of 7-[(2S,3R,4R,5S,6S)-3,5-dihydroxy-6-methyl-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-5-hydroxy-2-(4-hydroxyphenyl)-3-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-[[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxychromen-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/ccf4b420-8534-11ee-951b-136d8fe1c44a.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.50% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 98.24% | 91.49% |
CHEMBL2581 | P07339 | Cathepsin D | 97.43% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 97.38% | 89.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 96.32% | 94.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 96.13% | 86.33% |
CHEMBL3401 | O75469 | Pregnane X receptor | 92.88% | 94.73% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 92.07% | 95.64% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 90.80% | 86.92% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 90.03% | 99.15% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.46% | 96.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.05% | 99.17% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.95% | 97.09% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 85.66% | 95.78% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.86% | 95.56% |
CHEMBL242 | Q92731 | Estrogen receptor beta | 84.66% | 98.35% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 84.55% | 85.14% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.42% | 94.45% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.05% | 95.89% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 81.57% | 94.80% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 81.48% | 97.36% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 80.03% | 95.83% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Cardamine leucantha |
PubChem | 101494959 |
LOTUS | LTS0177955 |
wikiData | Q104998888 |