methyl 3,5-dihydroxy-7-[5-hydroxy-2,6-dimethyl-8-(2-methylbutanoyloxy)-3-oxo-2,5,6,7,8,8a-hexahydro-1H-naphthalen-1-yl]heptanoate
| Internal ID | cf09c4aa-91ed-419c-b614-11e8b0e43197 |
| Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty alcohols |
| IUPAC Name | methyl 3,5-dihydroxy-7-[5-hydroxy-2,6-dimethyl-8-(2-methylbutanoyloxy)-3-oxo-2,5,6,7,8,8a-hexahydro-1H-naphthalen-1-yl]heptanoate |
| SMILES (Canonical) | CCC(C)C(=O)OC1CC(C(C2=CC(=O)C(C(C12)CCC(CC(CC(=O)OC)O)O)C)O)C |
| SMILES (Isomeric) | CCC(C)C(=O)OC1CC(C(C2=CC(=O)C(C(C12)CCC(CC(CC(=O)OC)O)O)C)O)C |
| InChI | InChI=1S/C25H40O8/c1-6-13(2)25(31)33-21-9-14(3)24(30)19-12-20(28)15(4)18(23(19)21)8-7-16(26)10-17(27)11-22(29)32-5/h12-18,21,23-24,26-27,30H,6-11H2,1-5H3 |
| InChI Key | YGYWCCFAWCDWKW-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C25H40O8 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.27231823 g/mol |
| Topological Polar Surface Area (TPSA) | 130.00 Ų |
| XlogP | 1.80 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.26% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 97.89% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.21% | 91.11% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.97% | 97.25% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 94.33% | 85.14% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 91.76% | 96.47% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 91.62% | 91.19% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 89.90% | 90.17% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 87.81% | 93.56% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 87.69% | 95.93% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.02% | 97.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.99% | 94.45% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 83.88% | 97.14% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 83.64% | 94.33% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 82.97% | 98.75% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.95% | 90.71% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 82.37% | 96.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.26% | 99.17% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.99% | 96.00% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 81.78% | 96.90% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 80.37% | 95.71% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.08% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163065338 |
| LOTUS | LTS0073066 |
| wikiData | Q104201694 |