[17-[5,6-Dihydroxy-6-(2-hydroxypropan-2-yl)oxan-3-yl]-4,4,8,10,13-pentamethyl-3-oxo-5,6,7,9,11,12,16,17-octahydrocyclopenta[a]phenanthren-7-yl] acetate
Internal ID | 09000f2b-a57a-4686-aa0c-d3f89d38e203 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | [17-[5,6-dihydroxy-6-(2-hydroxypropan-2-yl)oxan-3-yl]-4,4,8,10,13-pentamethyl-3-oxo-5,6,7,9,11,12,16,17-octahydrocyclopenta[a]phenanthren-7-yl] acetate |
SMILES (Canonical) | CC(=O)OC1CC2C(C(=O)C=CC2(C3C1(C4=CCC(C4(CC3)C)C5CC(C(OC5)(C(C)(C)O)O)O)C)C)(C)C |
SMILES (Isomeric) | CC(=O)OC1CC2C(C(=O)C=CC2(C3C1(C4=CCC(C4(CC3)C)C5CC(C(OC5)(C(C)(C)O)O)O)C)C)(C)C |
InChI | InChI=1S/C32H48O7/c1-18(33)39-26-16-23-27(2,3)24(34)12-14-30(23,7)22-11-13-29(6)20(9-10-21(29)31(22,26)8)19-15-25(35)32(37,38-17-19)28(4,5)36/h10,12,14,19-20,22-23,25-26,35-37H,9,11,13,15-17H2,1-8H3 |
InChI Key | QMPWWBJWTUYRPO-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C32H48O7 |
Molecular Weight | 544.70 g/mol |
Exact Mass | 544.34000387 g/mol |
Topological Polar Surface Area (TPSA) | 113.00 Ų |
XlogP | 4.60 |
There are no found synonyms. |
![2D Structure of [17-[5,6-Dihydroxy-6-(2-hydroxypropan-2-yl)oxan-3-yl]-4,4,8,10,13-pentamethyl-3-oxo-5,6,7,9,11,12,16,17-octahydrocyclopenta[a]phenanthren-7-yl] acetate 2D Structure of [17-[5,6-Dihydroxy-6-(2-hydroxypropan-2-yl)oxan-3-yl]-4,4,8,10,13-pentamethyl-3-oxo-5,6,7,9,11,12,16,17-octahydrocyclopenta[a]phenanthren-7-yl] acetate](https://plantaedb.com/storage/docs/compounds/2023/11/cc708010-85bd-11ee-9104-079b82f68844.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.89% | 97.25% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.10% | 91.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.40% | 85.14% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.93% | 94.45% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.91% | 96.09% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 91.18% | 100.00% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 90.73% | 82.69% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.57% | 89.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.27% | 97.09% |
CHEMBL5028 | O14672 | ADAM10 | 88.47% | 97.50% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 88.44% | 96.77% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 87.68% | 91.19% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 86.78% | 97.28% |
CHEMBL2581 | P07339 | Cathepsin D | 85.76% | 98.95% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.49% | 99.23% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 85.37% | 97.14% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.93% | 95.56% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 84.08% | 91.07% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.90% | 86.33% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.02% | 95.89% |
CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 80.95% | 94.23% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.37% | 94.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Azadirachta indica |
PubChem | 75309353 |
LOTUS | LTS0070093 |
wikiData | Q105224108 |