[9-hydroxy-7,8-dimethyl-3-oxo-7-[2-(5-oxo-2H-furan-4-yl)ethyl]-5,6,6a,8,9,10-hexahydro-1H-benzo[d][2]benzofuran-5-yl] acetate
| Internal ID | 6a19dcda-a3c5-4131-b3d4-a4bc589ff792 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones > Diterpene lactones |
| IUPAC Name | [9-hydroxy-7,8-dimethyl-3-oxo-7-[2-(5-oxo-2H-furan-4-yl)ethyl]-5,6,6a,8,9,10-hexahydro-1H-benzo[d][2]benzofuran-5-yl] acetate |
| SMILES (Canonical) | CC1C(CC23COC(=O)C2=CC(CC3C1(C)CCC4=CCOC4=O)OC(=O)C)O |
| SMILES (Isomeric) | CC1C(CC23COC(=O)C2=CC(CC3C1(C)CCC4=CCOC4=O)OC(=O)C)O |
| InChI | InChI=1S/C22H28O7/c1-12-17(24)10-22-11-28-20(26)16(22)8-15(29-13(2)23)9-18(22)21(12,3)6-4-14-5-7-27-19(14)25/h5,8,12,15,17-18,24H,4,6-7,9-11H2,1-3H3 |
| InChI Key | PNENIROCKNMKOU-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C22H28O7 |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.18350323 g/mol |
| Topological Polar Surface Area (TPSA) | 99.10 Ų |
| XlogP | 2.40 |
| There are no found synonyms. |
![2D Structure of [9-hydroxy-7,8-dimethyl-3-oxo-7-[2-(5-oxo-2H-furan-4-yl)ethyl]-5,6,6a,8,9,10-hexahydro-1H-benzo[d][2]benzofuran-5-yl] acetate](https://plantaedb.com/storage/docs/compounds/2023/11/cc6faf50-8597-11ee-9093-152d147fc888.jpg "2D Structure of [9-hydroxy-7,8-dimethyl-3-oxo-7-[2-(5-oxo-2H-furan-4-yl)ethyl]-5,6,6a,8,9,10-hexahydro-1H-benzo[d][2]benzofuran-5-yl] acetate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.86% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.73% | 96.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.03% | 97.25% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 95.51% | 82.69% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 94.30% | 96.77% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 93.07% | 96.95% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.85% | 86.33% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.89% | 97.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.15% | 94.45% |
| CHEMBL2581 | P07339 | Cathepsin D | 88.87% | 98.95% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 85.55% | 96.61% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 84.96% | 91.19% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 84.54% | 97.79% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.78% | 100.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.48% | 99.23% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.16% | 95.56% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 82.01% | 85.14% |
| CHEMBL1944495 | P28065 | Proteasome subunit beta type-9 | 81.55% | 97.50% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 80.10% | 95.93% |
| CHEMBL5028 | O14672 | ADAM10 | 80.02% | 97.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Salvia melissodora |
| PubChem | 14262817 |
| LOTUS | LTS0097275 |
| wikiData | Q105211889 |