[(1R,2R,5S,7R,8R,9R,11R,12S,13S,15S)-8,15-diacetyloxy-11,13-dihydroxy-2,10,10,12-tetramethyl-6-methylidene-14-oxatetracyclo[9.3.1.19,13.02,7]hexadecan-5-yl] (E)-3-phenylprop-2-enoate
Internal ID | 0394dab5-da49-43d6-8cdb-bd590279c9fb |
Taxonomy | Phenylpropanoids and polyketides > Cinnamic acids and derivatives > Cinnamic acid esters |
IUPAC Name | [(1R,2R,5S,7R,8R,9R,11R,12S,13S,15S)-8,15-diacetyloxy-11,13-dihydroxy-2,10,10,12-tetramethyl-6-methylidene-14-oxatetracyclo[9.3.1.19,13.02,7]hexadecan-5-yl] (E)-3-phenylprop-2-enoate |
SMILES (Canonical) | CC1C2(CC3C(C4C(=C)C(CCC4(C(O2)C(C1(C3(C)C)O)OC(=O)C)C)OC(=O)C=CC5=CC=CC=C5)OC(=O)C)O |
SMILES (Isomeric) | C[C@@H]1[C@@]2(C[C@H]3[C@H]([C@@H]4C(=C)[C@H](CC[C@]4([C@@H](O2)[C@@H]([C@@]1(C3(C)C)O)OC(=O)C)C)OC(=O)/C=C/C5=CC=CC=C5)OC(=O)C)O |
InChI | InChI=1S/C33H42O9/c1-18-24(41-25(36)14-13-22-11-9-8-10-12-22)15-16-31(7)26(18)27(39-20(3)34)23-17-32(37)19(2)33(38,30(23,5)6)29(28(31)42-32)40-21(4)35/h8-14,19,23-24,26-29,37-38H,1,15-17H2,2-7H3/b14-13+/t19-,23+,24+,26+,27-,28+,29+,31-,32+,33+/m1/s1 |
InChI Key | ZNDNIKJPCFPZJG-OMQSHQQQSA-N |
Popularity | 0 references in papers |
Molecular Formula | C33H42O9 |
Molecular Weight | 582.70 g/mol |
Exact Mass | 582.28288291 g/mol |
Topological Polar Surface Area (TPSA) | 129.00 Ų |
XlogP | 3.90 |
There are no found synonyms. |
![2D Structure of [(1R,2R,5S,7R,8R,9R,11R,12S,13S,15S)-8,15-diacetyloxy-11,13-dihydroxy-2,10,10,12-tetramethyl-6-methylidene-14-oxatetracyclo[9.3.1.19,13.02,7]hexadecan-5-yl] (E)-3-phenylprop-2-enoate 2D Structure of [(1R,2R,5S,7R,8R,9R,11R,12S,13S,15S)-8,15-diacetyloxy-11,13-dihydroxy-2,10,10,12-tetramethyl-6-methylidene-14-oxatetracyclo[9.3.1.19,13.02,7]hexadecan-5-yl] (E)-3-phenylprop-2-enoate](https://plantaedb.com/storage/docs/compounds/2023/11/cc4e25f0-823d-11ee-ac17-d55fb697aa09.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 96.60% | 86.33% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 95.68% | 90.17% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.62% | 91.11% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 94.27% | 94.08% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.11% | 95.56% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.63% | 96.09% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 92.56% | 94.62% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 89.70% | 95.50% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 88.98% | 96.00% |
CHEMBL5028 | O14672 | ADAM10 | 88.00% | 97.50% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.28% | 89.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.50% | 99.23% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 83.41% | 100.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.98% | 95.89% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 81.63% | 93.99% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.39% | 97.14% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.92% | 91.19% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 80.00% | 93.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Taxus cuspidata |
PubChem | 163190376 |
LOTUS | LTS0134658 |
wikiData | Q105379984 |