ethyl 3-[3-methoxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]prop-2-enoate
Internal ID | 99e98335-005d-4f86-a5e0-4a0f49e9faf9 |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glycosyl compounds > Phenolic glycosides |
IUPAC Name | ethyl 3-[3-methoxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]prop-2-enoate |
SMILES (Canonical) | CCOC(=O)C=CC1=CC(=C(C=C1)OC2C(C(C(C(O2)CO)O)O)O)OC |
SMILES (Isomeric) | CCOC(=O)C=CC1=CC(=C(C=C1)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O)OC |
InChI | InChI=1S/C18H24O9/c1-3-25-14(20)7-5-10-4-6-11(12(8-10)24-2)26-18-17(23)16(22)15(21)13(9-19)27-18/h4-8,13,15-19,21-23H,3,9H2,1-2H3/t13-,15-,16+,17-,18-/m1/s1 |
InChI Key | IBNPXLCLALXSNA-SOVHRIKKSA-N |
Popularity | 0 references in papers |
Molecular Formula | C18H24O9 |
Molecular Weight | 384.40 g/mol |
Exact Mass | 384.14203234 g/mol |
Topological Polar Surface Area (TPSA) | 135.00 Ų |
XlogP | -0.40 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 97.80% | 96.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.33% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 96.74% | 86.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.65% | 89.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 92.46% | 94.73% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.66% | 99.17% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.25% | 95.56% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 85.72% | 89.62% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 84.79% | 91.11% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 83.02% | 92.94% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.65% | 97.09% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 80.57% | 96.95% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.52% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ipomoea nil |
PubChem | 162884526 |
LOTUS | LTS0177438 |
wikiData | Q105036586 |