10-[(5-hydroxy-5-methyl-8-propan-2-yl-4,4a,6,7,8,8a-hexahydro-3H-naphthalen-2-yl)methyl]-4b,8,8-trimethyl-2-propan-2-yl-5,6,7,8a,9,10-hexahydrophenanthren-3-ol
Internal ID | 2ba46024-0edc-4f07-857a-fbfdd86585d6 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids |
IUPAC Name | 10-[(5-hydroxy-5-methyl-8-propan-2-yl-4,4a,6,7,8,8a-hexahydro-3H-naphthalen-2-yl)methyl]-4b,8,8-trimethyl-2-propan-2-yl-5,6,7,8a,9,10-hexahydrophenanthren-3-ol |
SMILES (Canonical) | CC(C)C1CCC(C2C1C=C(CC2)CC3CC4C(CCCC4(C5=CC(=C(C=C35)C(C)C)O)C)(C)C)(C)O |
SMILES (Isomeric) | CC(C)C1CCC(C2C1C=C(CC2)CC3CC4C(CCCC4(C5=CC(=C(C=C35)C(C)C)O)C)(C)C)(C)O |
InChI | InChI=1S/C35H54O2/c1-21(2)25-12-15-35(8,37)29-11-10-23(17-28(25)29)16-24-18-32-33(5,6)13-9-14-34(32,7)30-20-31(36)26(22(3)4)19-27(24)30/h17,19-22,24-25,28-29,32,36-37H,9-16,18H2,1-8H3 |
InChI Key | ZBJRPMGEEOSMIM-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C35H54O2 |
Molecular Weight | 506.80 g/mol |
Exact Mass | 506.412380961 g/mol |
Topological Polar Surface Area (TPSA) | 40.50 Ų |
XlogP | 9.50 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.03% | 91.11% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 97.78% | 93.99% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.73% | 97.25% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.57% | 96.09% |
CHEMBL1978 | P11511 | Cytochrome P450 19A1 | 94.97% | 91.76% |
CHEMBL2581 | P07339 | Cathepsin D | 93.43% | 98.95% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 92.96% | 95.93% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 92.54% | 94.75% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.22% | 97.09% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 90.24% | 100.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.10% | 95.89% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.83% | 94.45% |
CHEMBL261 | P00915 | Carbonic anhydrase I | 88.79% | 96.76% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 88.04% | 93.40% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 88.01% | 90.71% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 86.28% | 89.62% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 85.99% | 99.15% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 85.94% | 91.03% |
CHEMBL1907598 | P05106 | Integrin alpha-V/beta-3 | 85.78% | 95.71% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 85.72% | 92.62% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 85.38% | 93.56% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.16% | 95.56% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 80.64% | 96.77% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Calocedrus formosana |
Cryptomeria japonica |
PubChem | 73007799 |
LOTUS | LTS0181121 |
wikiData | Q105370665 |