2-[[2-(4-Hydroxy-3,5-dimethoxyphenyl)-5-(3-hydroxypropyl)-7-methoxy-2,3-dihydro-1-benzofuran-3-yl]methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol
Internal ID | efc5af79-5885-4d33-9618-71786244af48 |
Taxonomy | Phenylpropanoids and polyketides > 2-arylbenzofuran flavonoids |
IUPAC Name | 2-[[2-(4-hydroxy-3,5-dimethoxyphenyl)-5-(3-hydroxypropyl)-7-methoxy-2,3-dihydro-1-benzofuran-3-yl]methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
SMILES (Canonical) | COC1=CC(=CC2=C1OC(C2COC3C(C(C(C(O3)CO)O)O)O)C4=CC(=C(C(=C4)OC)O)OC)CCCO |
SMILES (Isomeric) | COC1=CC(=CC2=C1OC(C2COC3C(C(C(C(O3)CO)O)O)O)C4=CC(=C(C(=C4)OC)O)OC)CCCO |
InChI | InChI=1S/C27H36O12/c1-34-17-9-14(10-18(35-2)21(17)30)25-16(12-37-27-24(33)23(32)22(31)20(11-29)38-27)15-7-13(5-4-6-28)8-19(36-3)26(15)39-25/h7-10,16,20,22-25,27-33H,4-6,11-12H2,1-3H3 |
InChI Key | NNZROSZBSRYBHT-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C27H36O12 |
Molecular Weight | 552.60 g/mol |
Exact Mass | 552.22067658 g/mol |
Topological Polar Surface Area (TPSA) | 177.00 Ų |
XlogP | 0.50 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 99.08% | 85.14% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.05% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.95% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 94.00% | 98.95% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.50% | 99.17% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 92.19% | 86.92% |
CHEMBL3401 | O75469 | Pregnane X receptor | 89.89% | 94.73% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 88.90% | 97.36% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.63% | 86.33% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 86.39% | 95.89% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.58% | 94.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.04% | 95.56% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.44% | 95.89% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.39% | 92.62% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.21% | 96.00% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 80.06% | 96.61% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Selaginella moellendorffii |
PubChem | 162952602 |
LOTUS | LTS0226212 |
wikiData | Q105182418 |