[3,4,5-Trihydroxy-6-[5-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-4-oxochromen-7-yl]oxyoxan-2-yl]methyl acetate
Internal ID | 4ab0e8be-d698-4f6d-ae4b-c73bc5aa8578 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-7-O-glycosides |
IUPAC Name | [3,4,5-trihydroxy-6-[5-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-4-oxochromen-7-yl]oxyoxan-2-yl]methyl acetate |
SMILES (Canonical) | CC(=O)OCC1C(C(C(C(O1)OC2=CC(=C3C(=C2)OC(=CC3=O)C4=CC(=C(C=C4)O)OC)O)O)O)O |
SMILES (Isomeric) | CC(=O)OCC1C(C(C(C(O1)OC2=CC(=C3C(=C2)OC(=CC3=O)C4=CC(=C(C=C4)O)OC)O)O)O)O |
InChI | InChI=1S/C24H24O12/c1-10(25)33-9-19-21(29)22(30)23(31)24(36-19)34-12-6-14(27)20-15(28)8-16(35-18(20)7-12)11-3-4-13(26)17(5-11)32-2/h3-8,19,21-24,26-27,29-31H,9H2,1-2H3 |
InChI Key | XTZWNKARHKPZRS-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C24H24O12 |
Molecular Weight | 504.40 g/mol |
Exact Mass | 504.12677620 g/mol |
Topological Polar Surface Area (TPSA) | 181.00 Ų |
XlogP | 0.90 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.16% | 91.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 98.63% | 85.14% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 96.92% | 94.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.71% | 89.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.33% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 94.61% | 98.95% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 93.14% | 99.15% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.20% | 86.33% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 89.77% | 91.49% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.63% | 94.45% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.54% | 99.17% |
CHEMBL3401 | O75469 | Pregnane X receptor | 88.42% | 94.73% |
CHEMBL3194 | P02766 | Transthyretin | 86.77% | 90.71% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 85.58% | 95.78% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.56% | 95.56% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.06% | 95.89% |
CHEMBL3438 | Q05513 | Protein kinase C zeta | 82.85% | 88.48% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 82.53% | 95.50% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.09% | 90.71% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.04% | 97.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Sideritis lanata |
PubChem | 163036224 |
LOTUS | LTS0209099 |
wikiData | Q105342019 |