Methyl 14,23-diacetyloxy-7-hydroxy-4-methoxy-6,16,22-trimethyl-25-(2-methylbut-2-enoyloxy)-3,9,11,17,20-pentaoxaoctacyclo[17.6.1.18,15.01,5.06,18.07,16.010,14.022,26]heptacos-12-ene-4-carboxylate
Internal ID | 247d36c8-3390-444b-b7f1-efe410cbe382 |
Taxonomy | Organoheterocyclic compounds > Naphthofurans |
IUPAC Name | methyl 14,23-diacetyloxy-7-hydroxy-4-methoxy-6,16,22-trimethyl-25-(2-methylbut-2-enoyloxy)-3,9,11,17,20-pentaoxaoctacyclo[17.6.1.18,15.01,5.06,18.07,16.010,14.022,26]heptacos-12-ene-4-carboxylate |
SMILES (Canonical) | CC=C(C)C(=O)OC1CC(C2(COC3C2C14COC(C4C5(C3OC6(C5(C7CC6C8(C=COC8O7)OC(=O)C)O)C)C)(C(=O)OC)OC)C)OC(=O)C |
SMILES (Isomeric) | CC=C(C)C(=O)OC1CC(C2(COC3C2C14COC(C4C5(C3OC6(C5(C7CC6C8(C=COC8O7)OC(=O)C)O)C)C)(C(=O)OC)OC)C)OC(=O)C |
InChI | InChI=1S/C37H48O15/c1-10-17(2)27(40)49-22-14-21(48-18(3)38)31(5)15-46-24-25(31)34(22)16-47-36(44-9,29(41)43-8)28(34)32(6)26(24)52-33(7)20-13-23(37(32,33)42)50-30-35(20,11-12-45-30)51-19(4)39/h10-12,20-26,28,30,42H,13-16H2,1-9H3 |
InChI Key | IFDBQDQJQMSEDP-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C37H48O15 |
Molecular Weight | 732.80 g/mol |
Exact Mass | 732.29932082 g/mol |
Topological Polar Surface Area (TPSA) | 181.00 Ų |
XlogP | 1.50 |
There are no found synonyms. |
![2D Structure of Methyl 14,23-diacetyloxy-7-hydroxy-4-methoxy-6,16,22-trimethyl-25-(2-methylbut-2-enoyloxy)-3,9,11,17,20-pentaoxaoctacyclo[17.6.1.18,15.01,5.06,18.07,16.010,14.022,26]heptacos-12-ene-4-carboxylate 2D Structure of Methyl 14,23-diacetyloxy-7-hydroxy-4-methoxy-6,16,22-trimethyl-25-(2-methylbut-2-enoyloxy)-3,9,11,17,20-pentaoxaoctacyclo[17.6.1.18,15.01,5.06,18.07,16.010,14.022,26]heptacos-12-ene-4-carboxylate](https://plantaedb.com/storage/docs/compounds/2023/11/cb444220-8620-11ee-b651-4d45459050d9.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.11% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.74% | 96.09% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 94.87% | 91.19% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.84% | 94.45% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.05% | 86.33% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 87.38% | 97.14% |
CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 86.66% | 97.47% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 86.57% | 97.28% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 86.46% | 92.94% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 86.02% | 90.17% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 85.91% | 89.50% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.40% | 100.00% |
CHEMBL284 | P27487 | Dipeptidyl peptidase IV | 85.38% | 95.69% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.24% | 99.23% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.54% | 89.00% |
CHEMBL5028 | O14672 | ADAM10 | 84.03% | 97.50% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 83.75% | 91.07% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 83.55% | 85.14% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.80% | 96.00% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 81.59% | 98.75% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.42% | 92.62% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.22% | 95.56% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.39% | 97.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Melia azedarach |
PubChem | 85246156 |
LOTUS | LTS0023284 |
wikiData | Q105112089 |