[9-(Hydroxymethyl)-3-methyl-6-methylidene-2,8-dioxo-3,3a,4,5,6a,7,9a,9b-octahydroazuleno[8,7-b]furan-9-yl] acetate
| Internal ID | 2a41bd61-9e71-4589-8348-48f16ffc7b3c |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones > Sesquiterpene lactones > Guaianolides and derivatives |
| IUPAC Name | [9-(hydroxymethyl)-3-methyl-6-methylidene-2,8-dioxo-3,3a,4,5,6a,7,9a,9b-octahydroazuleno[8,7-b]furan-9-yl] acetate |
| SMILES (Canonical) | CC1C2CCC(=C)C3CC(=O)C(C3C2OC1=O)(CO)OC(=O)C |
| SMILES (Isomeric) | CC1C2CCC(=C)C3CC(=O)C(C3C2OC1=O)(CO)OC(=O)C |
| InChI | InChI=1S/C17H22O6/c1-8-4-5-11-9(2)16(21)22-15(11)14-12(8)6-13(20)17(14,7-18)23-10(3)19/h9,11-12,14-15,18H,1,4-7H2,2-3H3 |
| InChI Key | BYTQBLSQDIOEOZ-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C17H22O6 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.14163842 g/mol |
| Topological Polar Surface Area (TPSA) | 89.90 Ų |
| XlogP | 1.10 |
| There are no found synonyms. |
![2D Structure of [9-(Hydroxymethyl)-3-methyl-6-methylidene-2,8-dioxo-3,3a,4,5,6a,7,9a,9b-octahydroazuleno[8,7-b]furan-9-yl] acetate](https://plantaedb.com/storage/docs/compounds/2023/11/cb42c0b0-83c0-11ee-a583-ff177451fb30.jpg "2D Structure of [9-(Hydroxymethyl)-3-methyl-6-methylidene-2,8-dioxo-3,3a,4,5,6a,7,9a,9b-octahydroazuleno[8,7-b]furan-9-yl] acetate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.05% | 91.11% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.71% | 97.25% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.73% | 96.09% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.02% | 97.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 86.48% | 98.95% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 86.26% | 92.94% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 86.23% | 85.14% |
| CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 85.32% | 89.05% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.20% | 100.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.83% | 86.33% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.49% | 91.19% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 82.87% | 93.04% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.82% | 99.23% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 81.28% | 94.45% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.53% | 94.00% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.22% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Centaurea musimonum |
| PubChem | 162921647 |
| LOTUS | LTS0080947 |
| wikiData | Q104949911 |