[(1S,7R,9S,10S,12R)-4,12-diacetyloxy-15-[3-(hexanoylamino)-2-hydroxy-3-phenylpropanoyl]oxy-1,9-dihydroxy-10,14,17,17-tetramethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate
Internal ID | ce9254fa-b46b-45fe-a629-f3a818783fdb |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Taxanes and derivatives |
IUPAC Name | [(1S,7R,9S,10S,12R)-4,12-diacetyloxy-15-[3-(hexanoylamino)-2-hydroxy-3-phenylpropanoyl]oxy-1,9-dihydroxy-10,14,17,17-tetramethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate |
SMILES (Canonical) | CCCCCC(=O)NC(C1=CC=CC=C1)C(C(=O)OC2CC3(C(C4C(C(CC5C4(CO5)OC(=O)C)O)(C(=O)C(C(=C2C)C3(C)C)OC(=O)C)C)OC(=O)C6=CC=CC=C6)O)O |
SMILES (Isomeric) | CCCCCC(=O)NC(C1=CC=CC=C1)C(C(=O)OC2C[C@]3(C(C4[C@@]([C@H](C[C@@H]5C4(CO5)OC(=O)C)O)(C(=O)[C@@H](C(=C2C)C3(C)C)OC(=O)C)C)OC(=O)C6=CC=CC=C6)O)O |
InChI | InChI=1S/C46H57NO14/c1-8-9-12-21-33(51)47-35(28-17-13-10-14-18-28)36(52)42(55)59-30-23-46(56)40(60-41(54)29-19-15-11-16-20-29)38-44(7,31(50)22-32-45(38,24-57-32)61-27(4)49)39(53)37(58-26(3)48)34(25(30)2)43(46,5)6/h10-11,13-20,30-32,35-38,40,50,52,56H,8-9,12,21-24H2,1-7H3,(H,47,51)/t30?,31-,32+,35?,36?,37+,38?,40?,44+,45?,46+/m0/s1 |
InChI Key | BEHTXUBGUDGCNQ-YWPUUOLLSA-N |
Popularity | 0 references in papers |
Molecular Formula | C46H57NO14 |
Molecular Weight | 847.90 g/mol |
Exact Mass | 847.37790549 g/mol |
Topological Polar Surface Area (TPSA) | 221.00 Ų |
XlogP | 2.70 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL1293294 | P51151 | Ras-related protein Rab-9A |
35.5 nM |
Potency |
via Super-PRED
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL221 | P23219 | Cyclooxygenase-1 | 99.90% | 90.17% |
CHEMBL2581 | P07339 | Cathepsin D | 99.75% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.16% | 91.11% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 97.55% | 99.17% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 97.13% | 95.17% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 95.65% | 97.79% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.55% | 86.33% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.01% | 96.09% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 93.27% | 99.23% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 92.87% | 96.47% |
CHEMBL230 | P35354 | Cyclooxygenase-2 | 92.50% | 89.63% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 90.77% | 82.69% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.34% | 97.09% |
CHEMBL2535 | P11166 | Glucose transporter | 89.91% | 98.75% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 89.87% | 95.50% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 89.73% | 85.14% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.31% | 95.56% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.81% | 94.45% |
CHEMBL5028 | O14672 | ADAM10 | 88.72% | 97.50% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 88.66% | 96.00% |
CHEMBL299 | P17252 | Protein kinase C alpha | 88.56% | 98.03% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 88.49% | 83.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 88.48% | 91.19% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 87.83% | 91.49% |
CHEMBL240 | Q12809 | HERG | 86.14% | 89.76% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 85.63% | 92.98% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.65% | 89.00% |
CHEMBL4267 | P37173 | TGF-beta receptor type II | 84.42% | 88.18% |
CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 84.11% | 81.11% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 83.13% | 98.75% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 82.89% | 94.62% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 82.12% | 94.08% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 81.80% | 96.90% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.23% | 97.14% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 81.19% | 93.56% |
CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 81.11% | 89.44% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 80.31% | 92.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Corylus avellana |
Taxus baccata |
Taxus cuspidata |
Taxus mairei |
Taxus wallichiana var. chinensis |
PubChem | 5321717 |
LOTUS | LTS0141235 |
wikiData | Q104932937 |