[4-[(2R)-3-[[(2R)-1-[(2S,3aS,6R,7aS)-2-[[(2S,3S)-1-carbamimidoyl-2-hydroxypiperidin-3-yl]carbamoyl]-6-hydroxy-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-4-methyl-1-oxopentan-2-yl]amino]-2-hydroxy-3-oxopropyl]-2-chlorophenyl] hydrogen sulfate
| Internal ID | 3ccdfca0-abb0-420e-b3db-1c5a4a02ff9a |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Alpha amino acids and derivatives > Leucine and derivatives |
| IUPAC Name | [4-[(2R)-3-[[(2R)-1-[(2S,3aS,6R,7aS)-2-[[(2S,3S)-1-carbamimidoyl-2-hydroxypiperidin-3-yl]carbamoyl]-6-hydroxy-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-4-methyl-1-oxopentan-2-yl]amino]-2-hydroxy-3-oxopropyl]-2-chlorophenyl] hydrogen sulfate |
| SMILES (Canonical) | CC(C)CC(C(=O)N1C2CC(CCC2CC1C(=O)NC3CCCN(C3O)C(=N)N)O)NC(=O)C(CC4=CC(=C(C=C4)OS(=O)(=O)O)Cl)O |
| SMILES (Isomeric) | CC(C)C[C@H](C(=O)N1[C@H]2C[C@@H](CC[C@H]2C[C@H]1C(=O)N[C@H]3CCCN([C@H]3O)C(=N)N)O)NC(=O)[C@@H](CC4=CC(=C(C=C4)OS(=O)(=O)O)Cl)O |
| InChI | InChI=1S/C30H45ClN6O10S/c1-15(2)10-21(35-27(41)24(39)12-16-5-8-25(19(31)11-16)47-48(44,45)46)29(43)37-22-14-18(38)7-6-17(22)13-23(37)26(40)34-20-4-3-9-36(28(20)42)30(32)33/h5,8,11,15,17-18,20-24,28,38-39,42H,3-4,6-7,9-10,12-14H2,1-2H3,(H3,32,33)(H,34,40)(H,35,41)(H,44,45,46)/t17-,18+,20-,21+,22-,23-,24+,28-/m0/s1 |
| InChI Key | HGPSINCIELURHW-OZNHPPRRSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C30H45ClN6O10S |
| Molecular Weight | 717.20 g/mol |
| Exact Mass | 716.2606405 g/mol |
| Topological Polar Surface Area (TPSA) | 264.00 Ų |
| XlogP | 1.50 |
| Atomic LogP (AlogP) | -0.12 |
| H-Bond Acceptor | 10 |
| H-Bond Donor | 8 |
| Rotatable Bonds | 11 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.8053 | 80.53% |
| Caco-2 | - | 0.8673 | 86.73% |
| Blood Brain Barrier | - | 0.6750 | 67.50% |
| Human oral bioavailability | - | 0.7286 | 72.86% |
| Subcellular localzation | Mitochondria | 0.3910 | 39.10% |
| OATP2B1 inhibitior | - | 0.5779 | 57.79% |
| OATP1B1 inhibitior | + | 0.8560 | 85.60% |
| OATP1B3 inhibitior | + | 0.9352 | 93.52% |
| MATE1 inhibitior | - | 0.7400 | 74.00% |
| OCT2 inhibitior | - | 0.5500 | 55.00% |
| BSEP inhibitior | + | 0.7757 | 77.57% |
| P-glycoprotein inhibitior | + | 0.7082 | 70.82% |
| P-glycoprotein substrate | + | 0.8724 | 87.24% |
| CYP3A4 substrate | + | 0.7439 | 74.39% |
| CYP2C9 substrate | - | 0.6109 | 61.09% |
| CYP2D6 substrate | - | 0.8129 | 81.29% |
| CYP3A4 inhibition | - | 0.7746 | 77.46% |
| CYP2C9 inhibition | - | 0.6922 | 69.22% |
| CYP2C19 inhibition | - | 0.6315 | 63.15% |
| CYP2D6 inhibition | - | 0.8339 | 83.39% |
| CYP1A2 inhibition | - | 0.7224 | 72.24% |
| CYP2C8 inhibition | + | 0.7029 | 70.29% |
| CYP inhibitory promiscuity | - | 0.7408 | 74.08% |
| UGT catelyzed | + | 0.7000 | 70.00% |
| Carcinogenicity (binary) | - | 0.6200 | 62.00% |
| Carcinogenicity (trinary) | Non-required | 0.5687 | 56.87% |
| Eye corrosion | - | 0.9760 | 97.60% |
| Eye irritation | - | 0.9224 | 92.24% |
| Skin irritation | - | 0.7542 | 75.42% |
| Skin corrosion | - | 0.9097 | 90.97% |
| Ames mutagenesis | - | 0.6800 | 68.00% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.5356 | 53.56% |
| Micronuclear | + | 0.9400 | 94.00% |
| Hepatotoxicity | - | 0.5000 | 50.00% |
| skin sensitisation | - | 0.8249 | 82.49% |
| Respiratory toxicity | + | 0.8444 | 84.44% |
| Reproductive toxicity | + | 0.9222 | 92.22% |
| Mitochondrial toxicity | + | 0.6625 | 66.25% |
| Nephrotoxicity | - | 0.8730 | 87.30% |
| Acute Oral Toxicity (c) | III | 0.5753 | 57.53% |
| Estrogen receptor binding | + | 0.8547 | 85.47% |
| Androgen receptor binding | + | 0.7116 | 71.16% |
| Thyroid receptor binding | + | 0.5243 | 52.43% |
| Glucocorticoid receptor binding | + | 0.7001 | 70.01% |
| Aromatase binding | + | 0.6584 | 65.84% |
| PPAR gamma | + | 0.7339 | 73.39% |
| Honey bee toxicity | - | 0.6893 | 68.93% |
| Biodegradation | - | 0.7500 | 75.00% |
| Crustacea aquatic toxicity | - | 0.6146 | 61.46% |
| Fish aquatic toxicity | + | 0.9724 | 97.24% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3837 | P07711 | Cathepsin L | 99.35% | 96.61% |
| CHEMBL2581 | P07339 | Cathepsin D | 99.23% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.95% | 96.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.39% | 94.45% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 97.50% | 90.17% |
| CHEMBL1801 | P00747 | Plasminogen | 96.38% | 92.44% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 96.13% | 98.33% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 96.02% | 95.89% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 95.63% | 91.19% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 94.53% | 97.14% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 94.05% | 90.71% |
| CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 94.00% | 96.03% |
| CHEMBL238 | Q01959 | Dopamine transporter | 93.16% | 95.88% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 93.16% | 91.03% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 93.09% | 93.56% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 92.97% | 96.00% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 92.79% | 96.90% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 92.36% | 99.18% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.36% | 95.56% |
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 91.88% | 95.58% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 91.81% | 95.50% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 91.42% | 96.95% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 91.22% | 100.00% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 90.72% | 97.21% |
| CHEMBL4835 | P00338 | L-lactate dehydrogenase A chain | 90.50% | 95.34% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 90.38% | 92.29% |
| CHEMBL205 | P00918 | Carbonic anhydrase II | 90.03% | 98.44% |
| CHEMBL4777 | P25929 | Neuropeptide Y receptor type 1 | 89.81% | 96.67% |
| CHEMBL4361 | Q07820 | Induced myeloid leukemia cell differentiation protein Mcl-1 | 89.72% | 95.52% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.49% | 97.09% |
| CHEMBL5028 | O14672 | ADAM10 | 89.12% | 97.50% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 89.09% | 90.00% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 88.80% | 100.00% |
| CHEMBL3202 | P48147 | Prolyl endopeptidase | 88.55% | 90.65% |
| CHEMBL3384 | Q16512 | Protein kinase N1 | 87.75% | 80.71% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 87.13% | 95.38% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 86.33% | 100.00% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 85.92% | 98.10% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 85.78% | 97.64% |
| CHEMBL3474 | P14555 | Phospholipase A2 group IIA | 85.30% | 94.05% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 84.86% | 96.21% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 84.74% | 90.24% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 84.50% | 94.33% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 84.34% | 96.67% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 83.81% | 93.03% |
| CHEMBL3023 | Q9NRA0 | Sphingosine kinase 2 | 83.04% | 95.61% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 82.71% | 93.10% |
| CHEMBL2095194 | P08709 | Coagulation factor VII/tissue factor | 82.68% | 99.17% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.60% | 95.89% |
| CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 82.52% | 97.50% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 82.47% | 96.38% |
| CHEMBL3729 | P22748 | Carbonic anhydrase IV | 81.82% | 99.23% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 81.61% | 94.66% |
| CHEMBL1907599 | P05556 | Integrin alpha-4/beta-1 | 81.56% | 92.86% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 81.52% | 98.75% |
| CHEMBL4816 | Q9Y243 | Serine/threonine-protein kinase AKT3 | 81.32% | 96.28% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 80.78% | 90.08% |
| CHEMBL2730 | P21980 | Protein-glutamine gamma-glutamyltransferase | 80.49% | 92.38% |
| CHEMBL1287628 | Q9Y5S8 | NADPH oxidase 1 | 80.28% | 95.48% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 80.06% | 89.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162899842 |
| LOTUS | LTS0276194 |
| wikiData | Q105027909 |