Catathelasmol A
| Internal ID | 73019e30-6ba4-4c93-8647-a4ffed21498d |
| Taxonomy | Organoheterocyclic compounds > Oxolanes |
| IUPAC Name | (2R)-2-(hydroxymethyl)oxolan-2-ol |
| SMILES (Canonical) | C1CC(OC1)(CO)O |
| SMILES (Isomeric) | C1C[C@@](OC1)(CO)O |
| InChI | InChI=1S/C5H10O3/c6-4-5(7)2-1-3-8-5/h6-7H,1-4H2/t5-/m1/s1 |
| InChI Key | VZKIEJBXBMKQCK-RXMQYKEDSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C5H10O3 |
| Molecular Weight | 118.13 g/mol |
| Exact Mass | 118.062994177 g/mol |
| Topological Polar Surface Area (TPSA) | 49.70 Ų |
| XlogP | -0.80 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.39% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.07% | 96.09% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 85.32% | 95.50% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.21% | 94.45% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 82.39% | 98.03% |
| CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 81.26% | 100.00% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 81.05% | 83.82% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 44131220 |
| LOTUS | LTS0097484 |
| wikiData | Q77499354 |