Carnosic acid gamma-lactone 12-methyl ether
Internal ID | 00b671d7-1f62-4f9a-9f09-5fbd4bf13c58 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones > Diterpene lactones |
IUPAC Name | (1R,6S)-12-methoxy-5,5-dimethyl-11-propan-2-yl-14-oxatetracyclo[7.6.1.01,6.013,16]hexadeca-9,11,13(16)-trien-15-one |
SMILES (Canonical) | CC(C)C1=C(C2=C3C(=C1)CCC4C3(CCCC4(C)C)C(=O)O2)OC |
SMILES (Isomeric) | CC(C)C1=C(C2=C3C(=C1)CC[C@@H]4[C@@]3(CCCC4(C)C)C(=O)O2)OC |
InChI | InChI=1S/C21H28O3/c1-12(2)14-11-13-7-8-15-20(3,4)9-6-10-21(15)16(13)18(17(14)23-5)24-19(21)22/h11-12,15H,6-10H2,1-5H3/t15-,21+/m0/s1 |
InChI Key | SRVNMMQHMRWDTR-YCRPNKLZSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C21H28O3 |
Molecular Weight | 328.40 g/mol |
Exact Mass | 328.20384475 g/mol |
Topological Polar Surface Area (TPSA) | 35.50 Ų |
XlogP | 5.50 |
Atomic LogP (AlogP) | 4.75 |
H-Bond Acceptor | 3 |
H-Bond Donor | 0 |
Rotatable Bonds | 2 |
Carnosic acid gamma-lactone 12-methyl ether |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.9964 | 99.64% |
Caco-2 | + | 0.8909 | 89.09% |
Blood Brain Barrier | + | 0.7000 | 70.00% |
Human oral bioavailability | + | 0.5143 | 51.43% |
Subcellular localzation | Mitochondria | 0.7597 | 75.97% |
OATP2B1 inhibitior | - | 0.8597 | 85.97% |
OATP1B1 inhibitior | + | 0.9171 | 91.71% |
OATP1B3 inhibitior | + | 0.9700 | 97.00% |
MATE1 inhibitior | - | 0.9400 | 94.00% |
OCT2 inhibitior | - | 0.6750 | 67.50% |
BSEP inhibitior | - | 0.4746 | 47.46% |
P-glycoprotein inhibitior | - | 0.5611 | 56.11% |
P-glycoprotein substrate | - | 0.7987 | 79.87% |
CYP3A4 substrate | + | 0.6459 | 64.59% |
CYP2C9 substrate | - | 0.5788 | 57.88% |
CYP2D6 substrate | - | 0.6906 | 69.06% |
CYP3A4 inhibition | + | 0.5273 | 52.73% |
CYP2C9 inhibition | - | 0.5262 | 52.62% |
CYP2C19 inhibition | + | 0.6867 | 68.67% |
CYP2D6 inhibition | - | 0.8693 | 86.93% |
CYP1A2 inhibition | + | 0.5599 | 55.99% |
CYP2C8 inhibition | - | 0.6389 | 63.89% |
CYP inhibitory promiscuity | - | 0.6547 | 65.47% |
UGT catelyzed | - | 0.0000 | 0.00% |
Carcinogenicity (binary) | - | 0.8700 | 87.00% |
Carcinogenicity (trinary) | Non-required | 0.5361 | 53.61% |
Eye corrosion | - | 0.9863 | 98.63% |
Eye irritation | - | 0.8074 | 80.74% |
Skin irritation | - | 0.7470 | 74.70% |
Skin corrosion | - | 0.9505 | 95.05% |
Ames mutagenesis | - | 0.7100 | 71.00% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.3876 | 38.76% |
Micronuclear | - | 0.8100 | 81.00% |
Hepatotoxicity | + | 0.5041 | 50.41% |
skin sensitisation | - | 0.8608 | 86.08% |
Respiratory toxicity | + | 0.6778 | 67.78% |
Reproductive toxicity | + | 0.6333 | 63.33% |
Mitochondrial toxicity | - | 0.5250 | 52.50% |
Nephrotoxicity | - | 0.7996 | 79.96% |
Acute Oral Toxicity (c) | III | 0.4758 | 47.58% |
Estrogen receptor binding | + | 0.7834 | 78.34% |
Androgen receptor binding | + | 0.5672 | 56.72% |
Thyroid receptor binding | + | 0.7245 | 72.45% |
Glucocorticoid receptor binding | + | 0.7552 | 75.52% |
Aromatase binding | + | 0.5290 | 52.90% |
PPAR gamma | + | 0.8210 | 82.10% |
Honey bee toxicity | - | 0.7956 | 79.56% |
Biodegradation | - | 0.8750 | 87.50% |
Crustacea aquatic toxicity | + | 0.5100 | 51.00% |
Fish aquatic toxicity | + | 0.9969 | 99.69% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.23% | 94.45% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.89% | 91.11% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.68% | 97.25% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 96.52% | 96.77% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 92.88% | 93.99% |
CHEMBL2581 | P07339 | Cathepsin D | 92.75% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.80% | 96.09% |
CHEMBL5203 | P33316 | dUTP pyrophosphatase | 91.51% | 99.18% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.51% | 95.56% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 89.88% | 96.38% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.86% | 97.09% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.92% | 95.89% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 87.15% | 94.00% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 87.12% | 93.56% |
CHEMBL2535 | P11166 | Glucose transporter | 87.08% | 98.75% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 86.68% | 90.71% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 86.58% | 92.62% |
CHEMBL1871 | P10275 | Androgen Receptor | 86.20% | 96.43% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.89% | 99.23% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 85.38% | 97.14% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.93% | 86.33% |
CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 84.70% | 94.03% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 84.09% | 93.04% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 83.53% | 95.71% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.40% | 100.00% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 83.35% | 93.40% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 83.15% | 94.75% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 82.46% | 91.07% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 81.76% | 96.21% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 80.69% | 82.69% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.20% | 89.00% |
CHEMBL4444 | P04070 | Vitamin K-dependent protein C | 80.08% | 93.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Salvia officinalis |
PubChem | 15775314 |
LOTUS | LTS0081511 |
wikiData | Q105259453 |