Carnemycin A
| Internal ID | f2d7bbf9-c93a-4331-b6d3-f967b75534c6 |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glycosyl compounds > Phenolic glycosides |
| IUPAC Name | ethyl 2,4-dihydroxy-6-nona-3,5-dienyl-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]benzoate |
| SMILES (Canonical) | CCCC=CC=CCCC1=CC(=C(C(=C1C(=O)OCC)O)C2C(C(C(C(O2)CO)O)O)O)O |
| SMILES (Isomeric) | CCCC=CC=CCCC1=CC(=C(C(=C1C(=O)OCC)O)C2C(C(C(C(O2)CO)O)O)O)O |
| InChI | InChI=1S/C24H34O9/c1-3-5-6-7-8-9-10-11-14-12-15(26)18(20(28)17(14)24(31)32-4-2)23-22(30)21(29)19(27)16(13-25)33-23/h6-9,12,16,19,21-23,25-30H,3-5,10-11,13H2,1-2H3 |
| InChI Key | HOXLOTVPTXYADA-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C24H34O9 |
| Molecular Weight | 466.50 g/mol |
| Exact Mass | 466.22028266 g/mol |
| Topological Polar Surface Area (TPSA) | 157.00 Ų |
| XlogP | 2.70 |
| ethyl 2,4-dihydroxy-6-nona-3,5-dienyl-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]benzoate |
| ethyl 2,4-dihydroxy-6-((3E,5E)-nona-3,5-dienyl)-3-((2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl)benzoate |
| Ethyl 2,4-dihydroxy-6-(nona-3,5-dien-1-yl)-3-(3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl)benzoic acid |
| Ethyl 2,4-dihydroxy-6-(nona-3,5-dien-1-yl)-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]benzoic acid |
| ethyl 2,4-dihydroxy-6-[(3E,5E)-nona-3,5-dienyl]-3-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]benzoate |
| ethyl 2,4-dihydroxy-6-nona-3,5-dienyl-3-(3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl)benzoate |
| RefChem:123770 |
| CHEBI:202401 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.18% | 91.11% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 96.03% | 94.73% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.75% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.72% | 98.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.96% | 99.17% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.80% | 86.33% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.78% | 89.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.88% | 95.56% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.20% | 96.00% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 82.80% | 96.95% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 82.36% | 92.50% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.97% | 97.09% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 80.47% | 93.65% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139584541 |
| LOTUS | LTS0133308 |
| wikiData | Q77371115 |