Cardanolmonoene
Internal ID | 5ca8ad9a-3bb1-4583-9693-81ef5e6e8962 |
Taxonomy | Benzenoids > Phenols > 1-hydroxy-4-unsubstituted benzenoids |
IUPAC Name | 3-[(E)-pentadec-8-enyl]phenol |
SMILES (Canonical) | CCCCCCC=CCCCCCCCC1=CC(=CC=C1)O |
SMILES (Isomeric) | CCCCCC/C=C/CCCCCCCC1=CC(=CC=C1)O |
InChI | InChI=1S/C21H34O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16-20-17-15-18-21(22)19-20/h7-8,15,17-19,22H,2-6,9-14,16H2,1H3/b8-7+ |
InChI Key | YLKVIMNNMLKUGJ-BQYQJAHWSA-N |
Popularity | 4 references in papers |
Molecular Formula | C21H34O |
Molecular Weight | 302.50 g/mol |
Exact Mass | 302.260965704 g/mol |
Topological Polar Surface Area (TPSA) | 20.20 Ų |
XlogP | 8.50 |
3-[(E)-pentadec-8-enyl]phenol |
3-(8-pentadecenyl)phenol |
Cardanol15:1 |
ANACARDOL |
3-(8-pentadecenyl)-phenol |
CHEBI:180808 |
3-(8-Pentadecenyl)-(Z)-Phenol |
3-[(8E)-pentadec-8-en-1-yl]phenol |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 99.06% | 98.95% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 98.67% | 92.08% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 96.79% | 99.17% |
CHEMBL240 | Q12809 | HERG | 94.50% | 89.76% |
CHEMBL3401 | O75469 | Pregnane X receptor | 93.22% | 94.73% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.80% | 86.33% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.78% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.59% | 91.11% |
CHEMBL236 | P41143 | Delta opioid receptor | 86.79% | 99.35% |
CHEMBL1907 | P15144 | Aminopeptidase N | 86.68% | 93.31% |
CHEMBL1781 | P11387 | DNA topoisomerase I | 86.32% | 97.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.30% | 95.56% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 84.90% | 91.71% |
CHEMBL3891 | P07384 | Calpain 1 | 84.53% | 93.04% |
CHEMBL5805 | Q9NR97 | Toll-like receptor 8 | 82.98% | 96.25% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 81.79% | 96.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 81.11% | 94.45% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 80.99% | 100.00% |
CHEMBL3227 | P41594 | Metabotropic glutamate receptor 5 | 80.05% | 96.42% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Anacardium occidentale |
Ginkgo biloba |
Knema elegans |
PubChem | 5315696 |
LOTUS | LTS0216393 |
wikiData | Q104193562 |