Carbonarone B
| Internal ID | d4911875-6a63-4f4a-9772-558b67866559 |
| Taxonomy | Organoheterocyclic compounds > Pyridines and derivatives > Pyridine carboxaldehydes |
| IUPAC Name | 6-benzyl-4-hydroxy-2-oxo-1H-pyridine-3-carbaldehyde |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C13H11NO3/c15-8-11-12(16)7-10(14-13(11)17)6-9-4-2-1-3-5-9/h1-5,7-8H,6H2,(H2,14,16,17) |
| InChI Key | OFDKPWCCYRMWNM-UHFFFAOYSA-N |
| Popularity | 3 references in papers |
| Molecular Formula | C13H11NO3 |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.07389321 g/mol |
| Topological Polar Surface Area (TPSA) | 66.40 Ų |
| XlogP | 1.70 |
| 6-benzyl-4-hydroxy-2-oxo-1H-pyridine-3-carbaldehyde |
| RefChem:123578 |
| CHEBI:197795 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 97.87% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.56% | 98.95% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 92.30% | 91.71% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.74% | 91.11% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 86.83% | 94.73% |
| CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 86.35% | 98.11% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 83.61% | 93.40% |
| CHEMBL2535 | P11166 | Glucose transporter | 83.22% | 98.75% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 81.71% | 96.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.40% | 86.33% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 81.39% | 93.03% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 80.13% | 95.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 135463540 |
| LOTUS | LTS0202570 |
| wikiData | Q75055213 |