Carbomethoxyvanillin
| Internal ID | 8d8ceb84-b7f5-4618-9f02-57868c70938d |
| Taxonomy | Benzenoids > Phenols > Methoxyphenols |
| IUPAC Name | methyl 2-(4-hydroxy-3-methoxyphenyl)-2-oxoacetate |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C10H10O5/c1-14-8-5-6(3-4-7(8)11)9(12)10(13)15-2/h3-5,11H,1-2H3 |
| InChI Key | PVRDAVSDHWPSOF-UHFFFAOYSA-N |
| Popularity | 3 references in papers |
| Molecular Formula | C10H10O5 |
| Molecular Weight | 210.18 g/mol |
| Exact Mass | 210.05282342 g/mol |
| Topological Polar Surface Area (TPSA) | 72.80 Ų |
| XlogP | 1.60 |
| DTXSID301247016 |
| Methyl 4-hydroxy-3-methoxy-alpha-oxobenzeneacetate |
| 1208246-43-8 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.71% | 91.11% |
| CHEMBL2535 | P11166 | Glucose transporter | 92.18% | 98.75% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.08% | 99.17% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 91.36% | 90.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.57% | 96.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.87% | 86.33% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 88.51% | 90.20% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.87% | 95.56% |
| CHEMBL3194 | P02766 | Transthyretin | 83.57% | 90.71% |
| CHEMBL1287628 | Q9Y5S8 | NADPH oxidase 1 | 82.15% | 95.48% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.45% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 101120927 |
| LOTUS | LTS0205742 |
| wikiData | Q105215568 |