Carapanaubine
Internal ID | 99cc5553-af32-4477-9aee-165c9cc7b2dc |
Taxonomy | Organoheterocyclic compounds > Indolizidines |
IUPAC Name | methyl (1S,4aS,5aS,6R,10aS)-5',6'-dimethoxy-1-methyl-2'-oxospiro[1,4a,5,5a,7,8,10,10a-octahydropyrano[3,4-f]indolizine-6,3'-1H-indole]-4-carboxylate |
SMILES (Canonical) | CC1C2CN3CCC4(C3CC2C(=CO1)C(=O)OC)C5=CC(=C(C=C5NC4=O)OC)OC |
SMILES (Isomeric) | C[C@H]1[C@@H]2CN3CC[C@]4([C@@H]3C[C@@H]2C(=CO1)C(=O)OC)C5=CC(=C(C=C5NC4=O)OC)OC |
InChI | InChI=1S/C23H28N2O6/c1-12-14-10-25-6-5-23(20(25)7-13(14)15(11-31-12)21(26)30-4)16-8-18(28-2)19(29-3)9-17(16)24-22(23)27/h8-9,11-14,20H,5-7,10H2,1-4H3,(H,24,27)/t12-,13-,14-,20-,23+/m0/s1 |
InChI Key | QIZNWMMOECVGAP-GHTUMPRVSA-N |
Popularity | 0 references in papers |
Molecular Formula | C23H28N2O6 |
Molecular Weight | 428.50 g/mol |
Exact Mass | 428.19473662 g/mol |
Topological Polar Surface Area (TPSA) | 86.30 Ų |
XlogP | 1.60 |
1255-02-3 |
C09106 |
AC1L9C5B |
methyl (1S,4aS,5aS,6R,10aS)-5',6'-dimethoxy-1-methyl-2'-oxospiro[1,4a,5,5a,7,8,10,10a-octahydropyrano[3,4-f]indolizine-6,3'-1H-indole]-4-carboxylate |
CHEBI:3384 |
DTXSID40331724 |
Q27106057 |
![2D Structure of Carapanaubine 2D Structure of Carapanaubine](https://plantaedb.com/storage/docs/compounds/2023/11/carapanaubine.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 99.33% | 85.14% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.33% | 96.09% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 93.92% | 92.94% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.32% | 91.11% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 92.76% | 90.71% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.77% | 86.33% |
CHEMBL4208 | P20618 | Proteasome component C5 | 88.11% | 90.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 87.99% | 91.19% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 87.64% | 91.07% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 85.75% | 97.14% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.31% | 94.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.64% | 97.09% |
CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 83.14% | 94.78% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.96% | 94.45% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 82.94% | 89.50% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.49% | 99.23% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 82.29% | 93.03% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.58% | 92.62% |
CHEMBL5028 | O14672 | ADAM10 | 80.87% | 97.50% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 80.25% | 94.42% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ochrosia alyxioides |
Rauvolfia volkensii |
Vinca difformis subsp. sardoa |
PubChem | 442037 |
LOTUS | LTS0165866 |
wikiData | Q27106057 |