Capsicoside A
Internal ID | 633293a4-0747-454d-8512-1ee6776c4d93 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
IUPAC Name | (2R,3R,4S,5S,6R)-2-[(2R)-4-[(1R,2S,4S,6R,7S,8R,9S,12S,13S,15R,16R,18S)-16-[(2R,3R,4S,5R,6R)-4-[(2S,3R,4R,5R,6R)-3,4-dihydroxy-5-[(2S,3R,4S,5R,6R)-5-hydroxy-6-(hydroxymethyl)-3,4-bis[[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy]oxan-2-yl]oxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6,15-dihydroxy-7,9,13-trimethyl-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosan-6-yl]-2-methylbutoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
SMILES (Canonical) | CC1C2C(CC3C2(CCC4C3CCC5C4(CC(C(C5)OC6C(C(C(C(O6)CO)O)OC7C(C(C(C(O7)CO)OC8C(C(C(C(O8)CO)O)OC9C(C(C(C(O9)CO)O)O)O)OC2C(C(C(C(O2)CO)O)O)O)O)O)O)O)C)C)OC1(CCC(C)COC1C(C(C(C(O1)CO)O)O)O)O |
SMILES (Isomeric) | C[C@H]1[C@H]2[C@H](C[C@@H]3[C@@]2(CC[C@H]4[C@H]3CC[C@@H]5[C@@]4(C[C@H]([C@@H](C5)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O[C@H]7[C@@H]([C@H]([C@H]([C@H](O7)CO)O[C@H]8[C@@H]([C@H]([C@@H]([C@H](O8)CO)O)O[C@H]9[C@@H]([C@H]([C@@H]([C@H](O9)CO)O)O)O)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O)O)O)O)O)C)C)O[C@@]1(CC[C@@H](C)CO[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O)O |
InChI | InChI=1S/C63H106O35/c1-21(20-86-55-46(80)42(76)37(71)30(14-64)88-55)7-10-63(85)22(2)36-29(98-63)12-26-24-6-5-23-11-28(27(70)13-62(23,4)25(24)8-9-61(26,36)3)87-59-50(84)52(40(74)33(17-67)91-59)95-58-49(83)45(79)51(35(19-69)93-58)94-60-54(97-57-48(82)44(78)39(73)32(16-66)90-57)53(41(75)34(18-68)92-60)96-56-47(81)43(77)38(72)31(15-65)89-56/h21-60,64-85H,5-20H2,1-4H3/t21-,22+,23+,24-,25+,26+,27-,28-,29+,30-,31-,32-,33-,34-,35-,36+,37-,38-,39-,40-,41-,42+,43+,44+,45-,46-,47-,48-,49-,50-,51+,52+,53+,54-,55-,56+,57+,58+,59-,60+,61+,62+,63-/m1/s1 |
InChI Key | WUSQCDWYDVFLMN-CIHABUNJSA-N |
Popularity | 0 references in papers |
Molecular Formula | C63H106O35 |
Molecular Weight | 1423.50 g/mol |
Exact Mass | 1422.6514651 g/mol |
Topological Polar Surface Area (TPSA) | 565.00 Ų |
XlogP | -5.60 |
Atomic LogP (AlogP) | -9.34 |
H-Bond Acceptor | 35 |
H-Bond Donor | 22 |
Rotatable Bonds | 22 |
C08889 |
CHEBI:3376 |
DTXSID00331649 |
Q27106053 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | - | 0.5246 | 52.46% |
Caco-2 | - | 0.8737 | 87.37% |
Blood Brain Barrier | - | 0.6750 | 67.50% |
Human oral bioavailability | - | 0.8429 | 84.29% |
Subcellular localzation | Mitochondria | 0.6174 | 61.74% |
OATP2B1 inhibitior | - | 1.0000 | 100.00% |
OATP1B1 inhibitior | + | 0.8730 | 87.30% |
OATP1B3 inhibitior | + | 0.9480 | 94.80% |
MATE1 inhibitior | - | 0.9612 | 96.12% |
OCT2 inhibitior | + | 0.6250 | 62.50% |
BSEP inhibitior | + | 0.8014 | 80.14% |
P-glycoprotein inhibitior | + | 0.7426 | 74.26% |
P-glycoprotein substrate | + | 0.5589 | 55.89% |
CYP3A4 substrate | + | 0.7537 | 75.37% |
CYP2C9 substrate | - | 0.8016 | 80.16% |
CYP2D6 substrate | - | 0.8288 | 82.88% |
CYP3A4 inhibition | - | 0.9473 | 94.73% |
CYP2C9 inhibition | - | 0.9215 | 92.15% |
CYP2C19 inhibition | - | 0.8997 | 89.97% |
CYP2D6 inhibition | - | 0.9561 | 95.61% |
CYP1A2 inhibition | - | 0.9215 | 92.15% |
CYP2C8 inhibition | + | 0.6703 | 67.03% |
CYP inhibitory promiscuity | - | 0.9616 | 96.16% |
UGT catelyzed | + | 0.7000 | 70.00% |
Carcinogenicity (binary) | - | 0.9800 | 98.00% |
Carcinogenicity (trinary) | Non-required | 0.6223 | 62.23% |
Eye corrosion | - | 0.9917 | 99.17% |
Eye irritation | - | 0.9000 | 90.00% |
Skin irritation | - | 0.6555 | 65.55% |
Skin corrosion | - | 0.9521 | 95.21% |
Ames mutagenesis | - | 0.8378 | 83.78% |
Human Ether-a-go-go-Related Gene inhibition | + | 0.8146 | 81.46% |
Micronuclear | - | 0.9100 | 91.00% |
Hepatotoxicity | - | 0.8533 | 85.33% |
skin sensitisation | - | 0.9420 | 94.20% |
Respiratory toxicity | + | 0.7333 | 73.33% |
Reproductive toxicity | + | 0.7000 | 70.00% |
Mitochondrial toxicity | - | 0.5375 | 53.75% |
Nephrotoxicity | - | 0.9223 | 92.23% |
Acute Oral Toxicity (c) | I | 0.8185 | 81.85% |
Estrogen receptor binding | + | 0.8570 | 85.70% |
Androgen receptor binding | + | 0.6928 | 69.28% |
Thyroid receptor binding | + | 0.5770 | 57.70% |
Glucocorticoid receptor binding | + | 0.6798 | 67.98% |
Aromatase binding | + | 0.6551 | 65.51% |
PPAR gamma | + | 0.7995 | 79.95% |
Honey bee toxicity | - | 0.5704 | 57.04% |
Biodegradation | - | 0.7750 | 77.50% |
Crustacea aquatic toxicity | - | 0.5900 | 59.00% |
Fish aquatic toxicity | + | 0.7523 | 75.23% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.53% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.64% | 91.11% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 96.41% | 96.61% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 95.87% | 92.86% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 95.19% | 96.21% |
CHEMBL220 | P22303 | Acetylcholinesterase | 95.03% | 94.45% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.79% | 97.09% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 92.78% | 95.93% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 92.64% | 92.98% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 92.21% | 97.29% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 91.65% | 100.00% |
CHEMBL237 | P41145 | Kappa opioid receptor | 91.46% | 98.10% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.76% | 94.45% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 90.65% | 93.18% |
CHEMBL2094135 | Q96BI3 | Gamma-secretase | 90.01% | 98.05% |
CHEMBL2534 | O15530 | 3-phosphoinositide dependent protein kinase-1 | 88.70% | 95.36% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 88.68% | 90.17% |
CHEMBL233 | P35372 | Mu opioid receptor | 88.49% | 97.93% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 88.09% | 95.89% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 87.83% | 95.58% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 87.75% | 93.56% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 87.07% | 89.05% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 86.93% | 96.38% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 86.87% | 95.50% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.64% | 95.89% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 86.59% | 97.79% |
CHEMBL4618 | P09960 | Leukotriene A4 hydrolase | 86.57% | 97.86% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 86.21% | 91.03% |
CHEMBL204 | P00734 | Thrombin | 85.02% | 96.01% |
CHEMBL2842 | P42345 | Serine/threonine-protein kinase mTOR | 84.83% | 92.78% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 84.66% | 92.50% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 83.73% | 100.00% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 83.60% | 97.14% |
CHEMBL259 | P32245 | Melanocortin receptor 4 | 83.53% | 95.38% |
CHEMBL206 | P03372 | Estrogen receptor alpha | 83.13% | 97.64% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 83.04% | 100.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.72% | 86.33% |
CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 82.28% | 95.71% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 82.14% | 96.47% |
CHEMBL5524 | Q99873 | Protein-arginine N-methyltransferase 1 | 82.13% | 96.67% |
CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 81.81% | 100.00% |
CHEMBL2360 | P00492 | Hypoxanthine-guanine phosphoribosyltransferase | 81.74% | 87.38% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 81.73% | 97.25% |
CHEMBL2730 | P21980 | Protein-glutamine gamma-glutamyltransferase | 81.51% | 92.38% |
CHEMBL2140 | P48775 | Tryptophan 2,3-dioxygenase | 81.15% | 98.46% |
CHEMBL2095194 | P08709 | Coagulation factor VII/tissue factor | 80.27% | 99.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Capsicum annuum |
PubChem | 441879 |
LOTUS | LTS0009917 |
wikiData | Q27106053 |