Capsianside C
Internal ID | 4df8c2d8-27a3-461f-8406-72c3f1cf4291 |
Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty acyl glycosides > Sophorolipids |
IUPAC Name | [2-[[6-[2-[(2Z,6E,10E)-14-[4,5-dihydroxy-6-(hydroxymethyl)-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-2,6,10,14-tetramethylhexadeca-2,6,10,15-tetraenoxy]-3,5-dihydroxy-6-methyloxan-4-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methoxy]-4,5-dihydroxy-6-methyloxan-3-yl] (2E,6E,10E)-14-[4,5-dihydroxy-6-(hydroxymethyl)-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-4-hydroxy-2,6,10,14-tetramethylhexadeca-2,6,10,15-tetraenoate |
SMILES (Canonical) | CC1C(C(C(C(O1)OCC2C(C(C(C(O2)OC3C(C(OC(C3O)OCC(=CCCC(=CCCC(=CCCC(C)(C=C)OC4C(C(C(C(O4)CO)O)O)OC5C(C(C(C(O5)CO)O)O)O)C)C)C)C)O)O)O)O)OC(=O)C(=CC(CC(=CCCC(=CCCC(C)(C=C)OC6C(C(C(C(O6)CO)O)O)OC7C(C(C(C(O7)CO)O)O)O)C)C)O)C)O)O |
SMILES (Isomeric) | CC1C(C(C(C(O1)OCC2C(C(C(C(O2)OC3C(C(OC(C3O)OC/C(=C\CC/C(=C/CC/C(=C/CCC(C)(C=C)OC4C(C(C(C(O4)CO)O)O)OC5C(C(C(C(O5)CO)O)O)O)/C)/C)/C)C)O)O)O)O)OC(=O)/C(=C/C(C/C(=C/CC/C(=C/CCC(C)(C=C)OC6C(C(C(C(O6)CO)O)O)OC7C(C(C(C(O7)CO)O)O)O)/C)/C)O)/C)O)O |
InChI | InChI=1S/C82H134O38/c1-13-81(11,119-79-71(63(99)56(92)49(34-85)112-79)117-75-65(101)59(95)54(90)47(32-83)110-75)28-18-26-39(4)21-15-20-38(3)23-17-25-42(7)36-106-74-68(104)69(53(89)45(10)108-74)116-77-67(103)61(97)58(94)51(114-77)37-107-78-70(62(98)52(88)44(9)109-78)115-73(105)43(8)31-46(87)30-41(6)24-16-22-40(5)27-19-29-82(12,14-2)120-80-72(64(100)57(93)50(35-86)113-80)118-76-66(102)60(96)55(91)48(33-84)111-76/h13-14,20,24-27,31,44-72,74-80,83-104H,1-2,15-19,21-23,28-30,32-37H2,3-12H3/b38-20+,39-26+,40-27+,41-24+,42-25-,43-31+ |
InChI Key | AWBYFCMZVKGNSB-RPQRBYGFSA-N |
Popularity | 4 references in papers |
Molecular Formula | C82H134O38 |
Molecular Weight | 1727.90 g/mol |
Exact Mass | 1726.8553098 g/mol |
Topological Polar Surface Area (TPSA) | 601.00 Ų |
XlogP | -0.70 |
SCHEMBL17305091 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.37% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.07% | 96.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 95.91% | 99.17% |
CHEMBL2581 | P07339 | Cathepsin D | 95.73% | 98.95% |
CHEMBL3401 | O75469 | Pregnane X receptor | 94.84% | 94.73% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.05% | 97.25% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.73% | 86.33% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 92.14% | 97.36% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.15% | 89.00% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 89.12% | 96.47% |
CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 86.46% | 95.71% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 85.77% | 97.21% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 84.60% | 98.75% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.26% | 96.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.99% | 97.09% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 83.73% | 96.95% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.41% | 91.19% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 83.40% | 93.56% |
CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 82.99% | 82.50% |
CHEMBL4015 | P41597 | C-C chemokine receptor type 2 | 82.65% | 98.57% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 82.28% | 94.33% |
CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 81.77% | 94.00% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.28% | 100.00% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 80.71% | 92.50% |
CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 80.19% | 85.00% |
CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 80.15% | 92.29% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 80.07% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Capsicum annuum |
PubChem | 118550826 |
LOTUS | LTS0154456 |
wikiData | Q104396638 |