Caprarioside
Internal ID | 1e044b2d-cef1-4f13-a941-3f10fae7eddb |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Iridoid O-glycosides |
IUPAC Name | [(1S,4aS,5R,7S,7aS)-4a,5-dihydroxy-7-methyl-1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,5,6,7a-tetrahydrocyclopenta[c]pyran-7-yl] benzoate |
SMILES (Canonical) | CC1(CC(C2(C1C(OC=C2)OC3C(C(C(C(O3)CO)O)O)O)O)O)OC(=O)C4=CC=CC=C4 |
SMILES (Isomeric) | C[C@@]1(C[C@H]([C@]2([C@@H]1[C@@H](OC=C2)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)O)O)OC(=O)C4=CC=CC=C4 |
InChI | InChI=1S/C22H28O11/c1-21(33-18(28)11-5-3-2-4-6-11)9-13(24)22(29)7-8-30-20(17(21)22)32-19-16(27)15(26)14(25)12(10-23)31-19/h2-8,12-17,19-20,23-27,29H,9-10H2,1H3/t12-,13-,14-,15+,16-,17-,19+,20+,21+,22-/m1/s1 |
InChI Key | SMCDFJHVOYELKQ-UHXGZAEASA-N |
Popularity | 0 references in papers |
Molecular Formula | C22H28O11 |
Molecular Weight | 468.40 g/mol |
Exact Mass | 468.16316171 g/mol |
Topological Polar Surface Area (TPSA) | 175.00 Ų |
XlogP | -1.00 |
1151862-69-9 |
[(1S,4aS,5R,7S,7aS)-4a,5-dihydroxy-7-methyl-1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,5,6,7a-tetrahydrocyclopenta[c]pyran-7-yl] benzoate |
AKOS040762753 |
F92882 |
![2D Structure of Caprarioside 2D Structure of Caprarioside](https://plantaedb.com/storage/docs/compounds/2023/11/caprarioside.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL221 | P23219 | Cyclooxygenase-1 | 97.79% | 90.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.98% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.40% | 91.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.32% | 86.33% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 90.74% | 91.49% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 88.03% | 94.62% |
CHEMBL2581 | P07339 | Cathepsin D | 85.60% | 98.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.86% | 97.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.12% | 95.56% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 82.76% | 96.61% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.76% | 99.23% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.21% | 89.00% |
CHEMBL5028 | O14672 | ADAM10 | 81.60% | 97.50% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 80.53% | 94.08% |
CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 80.13% | 94.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Phlogacanthus curviflorus |
PubChem | 134715068 |
LOTUS | LTS0187699 |
wikiData | Q105255831 |