Camporidine B
| Internal ID | ec7e32fe-edc6-47a3-bb02-998e939a268a |
| Taxonomy | Organoheterocyclic compounds > Epoxypiperidines |
| IUPAC Name | (E)-4-[(1S,3R,4S,7S)-4-hexyl-6-hydroxy-2-oxa-6-azatricyclo[5.3.0.01,3]dec-8-en-10-ylidene]but-2-enoic acid |
| SMILES (Canonical) | CCCCCCC1CN(C2C=CC(=CC=CC(=O)O)C23C1O3)O |
| SMILES (Isomeric) | CCCCCC[C@H]1CN([C@H]2C=CC(=C/C=C/C(=O)O)[C@@]23[C@@H]1O3)O |
| InChI | InChI=1S/C18H25NO4/c1-2-3-4-5-7-13-12-19(22)15-11-10-14(8-6-9-16(20)21)18(15)17(13)23-18/h6,8-11,13,15,17,22H,2-5,7,12H2,1H3,(H,20,21)/b9-6+,14-8?/t13-,15-,17+,18-/m0/s1 |
| InChI Key | HEOCGAUXAHXHLX-XSJMJMTMSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C18H25NO4 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.17835828 g/mol |
| Topological Polar Surface Area (TPSA) | 73.30 Ų |
| XlogP | 0.60 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 99.83% | 89.63% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.14% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.84% | 98.95% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 93.24% | 93.56% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 92.33% | 92.86% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 92.06% | 90.17% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 89.10% | 91.81% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 89.01% | 100.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.68% | 99.17% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 88.37% | 91.11% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 88.20% | 97.25% |
| CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 87.06% | 94.08% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 85.95% | 100.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.39% | 86.33% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.39% | 95.56% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.10% | 94.45% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 84.32% | 95.50% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 84.21% | 92.08% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 80.18% | 96.61% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 145720860 |
| LOTUS | LTS0211690 |
| wikiData | Q105026944 |