Campestanyl ferulate
Internal ID | 1589bf30-b247-4667-ab45-ddff9c41a9ea |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroid esters |
IUPAC Name | [(3S,5S,8R,9S,10S,13R,14S,17R)-17-[(2R,5R)-5,6-dimethylheptan-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
SMILES (Canonical) | CC(C)C(C)CCC(C)C1CCC2C1(CCC3C2CCC4C3(CCC(C4)OC(=O)C=CC5=CC(=C(C=C5)O)OC)C)C |
SMILES (Isomeric) | C[C@H](CC[C@@H](C)C(C)C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC[C@@H]4[C@@]3(CC[C@@H](C4)OC(=O)/C=C/C5=CC(=C(C=C5)O)OC)C)C |
InChI | InChI=1S/C38H58O4/c1-24(2)25(3)8-9-26(4)31-14-15-32-30-13-12-28-23-29(18-20-37(28,5)33(30)19-21-38(31,32)6)42-36(40)17-11-27-10-16-34(39)35(22-27)41-7/h10-11,16-17,22,24-26,28-33,39H,8-9,12-15,18-21,23H2,1-7H3/b17-11+/t25-,26-,28+,29+,30+,31-,32+,33+,37+,38-/m1/s1 |
InChI Key | NLHPCZDTMWKEFC-GTKUFFLCSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C38H58O4 |
Molecular Weight | 578.90 g/mol |
Exact Mass | 578.43351033 g/mol |
Topological Polar Surface Area (TPSA) | 55.80 Ų |
XlogP | 11.90 |
trans-Feruloylcampestanol |
Campestanol trans-ferulate |
trans-Campestanyl ferulate |
UNII-GID12I848G |
GID12I848G |
106774-77-0 |
Ergostan-3-ol, 3-((2E)-3-(4-hydroxy-3-methoxyphenyl)-2-propenoate), (3beta,5alpha,24R)- |
CHEMBL3799176 |
Q27279117 |
115587-23-0 |
There are more than 10 synonyms. If you wish to see them all click here. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.46% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.10% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.46% | 94.45% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 95.25% | 96.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.16% | 95.56% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 93.90% | 89.62% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.05% | 86.33% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.62% | 97.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.44% | 89.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 89.83% | 95.89% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.72% | 99.17% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 86.43% | 90.71% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.01% | 100.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 85.42% | 91.19% |
CHEMBL4208 | P20618 | Proteasome component C5 | 85.17% | 90.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.72% | 95.89% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 84.63% | 92.62% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 83.75% | 92.94% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 83.60% | 100.00% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 83.21% | 91.07% |
CHEMBL3492 | P49721 | Proteasome Macropain subunit | 83.09% | 90.24% |
CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 81.93% | 85.31% |
CHEMBL5028 | O14672 | ADAM10 | 80.74% | 97.50% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 80.49% | 94.08% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 80.41% | 89.50% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.37% | 97.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Coix lacryma-jobi |
Zea mays |
PubChem | 13786591 |
LOTUS | LTS0219822 |
wikiData | Q27279117 |