Calystegine C2
Internal ID | 5c857191-b945-4ef6-883a-9d0bf6f31579 |
Taxonomy | Alkaloids and derivatives > Tropane alkaloids |
IUPAC Name | (1R,2R,3R,4S,5R,6R)-8-azabicyclo[3.2.1]octane-1,2,3,4,6-pentol |
SMILES (Canonical) | C1C(C2C(C(C(C1(N2)O)O)O)O)O |
SMILES (Isomeric) | C1[C@H]([C@@H]2[C@@H]([C@H]([C@H]([C@]1(N2)O)O)O)O)O |
InChI | InChI=1S/C7H13NO5/c9-2-1-7(13)6(12)5(11)4(10)3(2)8-7/h2-6,8-13H,1H2/t2-,3-,4+,5-,6-,7-/m1/s1 |
InChI Key | GGOJRYWHKVYFQK-AGZHHQKVSA-N |
Popularity | 0 references in papers |
Molecular Formula | C7H13NO5 |
Molecular Weight | 191.18 g/mol |
Exact Mass | 191.07937252 g/mol |
Topological Polar Surface Area (TPSA) | 113.00 Ų |
XlogP | -3.40 |
190957-44-9 |
2-epi-Calystegine C1 |
(1R,2R,3R,4S,5R,6R)-8-azabicyclo[3.2.1]octane-1,2,3,4,6-pentol |
8-Azabicyclo(3.2.1)octane-1,2,3,4,6-pentol, (1R,2R,3R,4S,5R,6R)- |
AKOS040735469 |
FS-6669 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.23% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.74% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.85% | 97.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 86.50% | 97.25% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 82.02% | 94.75% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.04% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Duboisia leichhardtii |
PubChem | 101700059 |
LOTUS | LTS0142057 |
wikiData | Q105008239 |