Calanhydroquinone A
| Internal ID | 5b5d474a-b0e3-4033-9d7e-08e632dc8c15 |
| Taxonomy | Benzenoids > Phenanthrenes and derivatives > Hydrophenanthrenes |
| IUPAC Name | 5,7-dimethoxy-9,10-dihydrophenanthrene-1,4,6-triol |
| SMILES (Canonical) | COC1=C(C(=C2C(=C1)CCC3=C(C=CC(=C32)O)O)OC)O |
| SMILES (Isomeric) | COC1=C(C(=C2C(=C1)CCC3=C(C=CC(=C32)O)O)OC)O |
| InChI | InChI=1S/C16H16O5/c1-20-12-7-8-3-4-9-10(17)5-6-11(18)14(9)13(8)16(21-2)15(12)19/h5-7,17-19H,3-4H2,1-2H3 |
| InChI Key | HUXUPTMINAVZIB-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C16H16O5 |
| Molecular Weight | 288.29 g/mol |
| Exact Mass | 288.09977361 g/mol |
| Topological Polar Surface Area (TPSA) | 79.20 Ų |
| XlogP | 2.70 |
| CHEMBL539644 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.16% | 91.11% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 97.12% | 91.49% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.40% | 96.09% |
| CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 91.34% | 98.11% |
| CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 89.72% | 92.68% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.85% | 86.33% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.61% | 95.56% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 88.24% | 90.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 88.01% | 98.75% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.25% | 94.45% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 86.57% | 91.79% |
| CHEMBL2002 | P12268 | Inosine-5'-monophosphate dehydrogenase 2 | 86.40% | 98.21% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.34% | 99.17% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 84.28% | 99.15% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 83.25% | 91.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.08% | 94.00% |
| CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 81.77% | 95.64% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 80.63% | 95.62% |
| CHEMBL3438 | Q05513 | Protein kinase C zeta | 80.57% | 88.48% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.06% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Calanthe arisanensis |
| PubChem | 25243532 |
| LOTUS | LTS0135862 |
| wikiData | Q105034118 |