Caerulomycin F
| Internal ID | 22c2f92c-ec38-485b-852d-9d64f9598270 |
| Taxonomy | Organoheterocyclic compounds > Pyridines and derivatives > Bipyridines and oligopyridines |
| IUPAC Name | (4-methoxy-6-pyridin-2-ylpyridin-2-yl)methanol |
| SMILES (Canonical) | COC1=CC(=NC(=C1)C2=CC=CC=N2)CO |
| SMILES (Isomeric) | COC1=CC(=NC(=C1)C2=CC=CC=N2)CO |
| InChI | InChI=1S/C12H12N2O2/c1-16-10-6-9(8-15)14-12(7-10)11-4-2-3-5-13-11/h2-7,15H,8H2,1H3 |
| InChI Key | PELLYAWYWQZSJV-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C12H12N2O2 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.089877630 g/mol |
| Topological Polar Surface Area (TPSA) | 55.20 Ų |
| XlogP | 0.60 |
| CHEBI:69225 |
| (4-methoxy-2,2'-bipyridin-6-yl)methanol |
| (4-methoxy-6-pyridin-2-ylpyridin-2-yl)methanol |
| RefChem:122624 |
| CHEMBL1823031 |
| SCHEMBL29884857 |
| Q27137564 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.55% | 96.09% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 94.37% | 93.10% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.86% | 86.33% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.43% | 91.11% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.36% | 94.00% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 89.77% | 90.00% |
| CHEMBL2243 | O00519 | Anandamide amidohydrolase | 89.27% | 97.53% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 87.84% | 85.14% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 86.39% | 94.73% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.28% | 99.17% |
| CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 85.74% | 89.44% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 84.84% | 95.50% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.68% | 96.00% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 83.33% | 96.67% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 83.14% | 100.00% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 82.03% | 99.15% |
| CHEMBL2885 | P07451 | Carbonic anhydrase III | 81.69% | 87.45% |
| CHEMBL2535 | P11166 | Glucose transporter | 81.38% | 98.75% |
| CHEMBL3524 | P56524 | Histone deacetylase 4 | 80.87% | 92.97% |
| CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 80.81% | 100.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 80.36% | 98.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 25192237 |
| LOTUS | LTS0221512 |
| wikiData | Q103819089 |