5-[[(Z)-1-[(2S)-2-[[(2R)-1-[[(2R)-1-[[(2R)-1-[[(2S)-1-[[(2R)-1-[[(2S)-1-[[(2R)-1-[[(2S)-5-amino-1-[[(2R)-1-[[(2R)-1-[[(Z)-1-[[(3R,6R,9R,12S,15S,16R)-3-(4-aminobutyl)-6-(2-aminoethyl)-12-[(2S)-butan-2-yl]-9-(2-hydroxyethyl)-16-methyl-2,5,8,11,14-pentaoxo-1-oxa-4,7,10,13-tetrazacyclohexadec-15-yl]amino]-1-oxobut-2-en-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-1,5-dioxopentan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]carbamoyl]pyrrolidin-1-yl]-1-oxobut-2-en-2-yl]amino]-5-oxopentanoic acid
| Internal ID | 67a066a9-4e95-492a-8fc2-2a1731101cfc |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Depsipeptides > Cyclic depsipeptides |
| IUPAC Name | 5-[[(Z)-1-[(2S)-2-[[(2R)-1-[[(2R)-1-[[(2R)-1-[[(2S)-1-[[(2R)-1-[[(2S)-1-[[(2R)-1-[[(2S)-5-amino-1-[[(2R)-1-[[(2R)-1-[[(Z)-1-[[(3R,6R,9R,12S,15S,16R)-3-(4-aminobutyl)-6-(2-aminoethyl)-12-[(2S)-butan-2-yl]-9-(2-hydroxyethyl)-16-methyl-2,5,8,11,14-pentaoxo-1-oxa-4,7,10,13-tetrazacyclohexadec-15-yl]amino]-1-oxobut-2-en-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-1,5-dioxopentan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]carbamoyl]pyrrolidin-1-yl]-1-oxobut-2-en-2-yl]amino]-5-oxopentanoic acid |
| SMILES (Canonical) | CCC(C)C1C(=O)NC(C(=O)NC(C(=O)NC(C(=O)OC(C(C(=O)N1)NC(=O)C(=CC)NC(=O)C(C(C)C)NC(=O)C(CC(C)C)NC(=O)C(CCC(=O)N)NC(=O)C(C(C)C)NC(=O)C(C(C)C)NC(=O)C(CC(C)C)NC(=O)C(CO)NC(=O)C(C(C)C)NC(=O)C(CC(C)C)NC(=O)C(CO)NC(=O)C2CCCN2C(=O)C(=CC)NC(=O)CCCC(=O)O)C)CCCCN)CCN)CCO |
| SMILES (Isomeric) | CC[C@H](C)[C@H]1C(=O)N[C@@H](C(=O)N[C@@H](C(=O)N[C@@H](C(=O)O[C@@H]([C@@H](C(=O)N1)NC(=O)/C(=C/C)/NC(=O)[C@@H](C(C)C)NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](CCC(=O)N)NC(=O)[C@@H](C(C)C)NC(=O)[C@H](C(C)C)NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)[C@@H](C(C)C)NC(=O)[C@@H](CC(C)C)NC(=O)[C@@H](CO)NC(=O)[C@@H]2CCCN2C(=O)/C(=C/C)/NC(=O)CCCC(=O)O)C)CCCCN)CCN)CCO |
| InChI | InChI=1S/C91H155N21O26/c1-20-51(18)72-88(134)99-57(34-38-113)77(123)97-56(33-36-93)76(122)100-58(27-23-24-35-92)91(137)138-52(19)73(89(135)110-72)111-74(120)53(21-2)96-84(130)68(47(10)11)106-78(124)59(39-44(4)5)101-75(121)55(31-32-65(94)116)98-85(131)70(49(14)15)109-87(133)71(50(16)17)108-80(126)61(41-46(8)9)103-82(128)63(43-115)105-86(132)69(48(12)13)107-79(125)60(40-45(6)7)102-81(127)62(42-114)104-83(129)64-28-26-37-112(64)90(136)54(22-3)95-66(117)29-25-30-67(118)119/h21-22,44-52,55-64,68-73,113-115H,20,23-43,92-93H2,1-19H3,(H2,94,116)(H,95,117)(H,96,130)(H,97,123)(H,98,131)(H,99,134)(H,100,122)(H,101,121)(H,102,127)(H,103,128)(H,104,129)(H,105,132)(H,106,124)(H,107,125)(H,108,126)(H,109,133)(H,110,135)(H,111,120)(H,118,119)/b53-21-,54-22-/t51-,52+,55-,56+,57+,58+,59+,60+,61+,62+,63-,64-,68+,69+,70+,71-,72-,73-/m0/s1 |
| InChI Key | FLJZFCSEBDJGSB-XRXSERHUSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C91H155N21O26 |
| Molecular Weight | 1959.30 g/mol |
| Exact Mass | 1958.14521413 g/mol |
| Topological Polar Surface Area (TPSA) | 734.00 Ų |
| XlogP | -1.90 |
| Atomic LogP (AlogP) | -4.59 |
| H-Bond Acceptor | 27 |
| H-Bond Donor | 24 |
| Rotatable Bonds | 55 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.5905 | 59.05% |
| Caco-2 | - | 0.8589 | 85.89% |
| Blood Brain Barrier | - | 0.9000 | 90.00% |
| Human oral bioavailability | - | 0.5429 | 54.29% |
| Subcellular localzation | Lysosomes | 0.5231 | 52.31% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.8203 | 82.03% |
| OATP1B3 inhibitior | + | 0.9255 | 92.55% |
| MATE1 inhibitior | - | 0.9600 | 96.00% |
| OCT2 inhibitior | - | 0.9500 | 95.00% |
| BSEP inhibitior | + | 0.9740 | 97.40% |
| P-glycoprotein inhibitior | + | 0.7418 | 74.18% |
| P-glycoprotein substrate | + | 0.8723 | 87.23% |
| CYP3A4 substrate | + | 0.7440 | 74.40% |
| CYP2C9 substrate | - | 0.5958 | 59.58% |
| CYP2D6 substrate | - | 0.8608 | 86.08% |
| CYP3A4 inhibition | - | 0.8493 | 84.93% |
| CYP2C9 inhibition | - | 0.8979 | 89.79% |
| CYP2C19 inhibition | - | 0.8729 | 87.29% |
| CYP2D6 inhibition | - | 0.9214 | 92.14% |
| CYP1A2 inhibition | - | 0.8931 | 89.31% |
| CYP2C8 inhibition | + | 0.7663 | 76.63% |
| CYP inhibitory promiscuity | - | 0.9761 | 97.61% |
| UGT catelyzed | + | 0.6000 | 60.00% |
| Carcinogenicity (binary) | - | 0.8600 | 86.00% |
| Carcinogenicity (trinary) | Non-required | 0.5325 | 53.25% |
| Eye corrosion | - | 0.9837 | 98.37% |
| Eye irritation | - | 0.8954 | 89.54% |
| Skin irritation | - | 0.7581 | 75.81% |
| Skin corrosion | - | 0.9100 | 91.00% |
| Ames mutagenesis | - | 0.7500 | 75.00% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.6980 | 69.80% |
| Micronuclear | + | 0.8400 | 84.00% |
| Hepatotoxicity | + | 0.5334 | 53.34% |
| skin sensitisation | - | 0.8479 | 84.79% |
| Respiratory toxicity | + | 0.7667 | 76.67% |
| Reproductive toxicity | + | 0.8778 | 87.78% |
| Mitochondrial toxicity | + | 0.8250 | 82.50% |
| Nephrotoxicity | + | 0.6866 | 68.66% |
| Acute Oral Toxicity (c) | III | 0.5754 | 57.54% |
| Estrogen receptor binding | - | 0.4743 | 47.43% |
| Androgen receptor binding | + | 0.7355 | 73.55% |
| Thyroid receptor binding | + | 0.7281 | 72.81% |
| Glucocorticoid receptor binding | + | 0.8013 | 80.13% |
| Aromatase binding | + | 0.8093 | 80.93% |
| PPAR gamma | + | 0.7856 | 78.56% |
| Honey bee toxicity | - | 0.6886 | 68.86% |
| Biodegradation | - | 0.8250 | 82.50% |
| Crustacea aquatic toxicity | - | 0.5600 | 56.00% |
| Fish aquatic toxicity | - | 0.4347 | 43.47% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3837 | P07711 | Cathepsin L | 99.97% | 96.61% |
| CHEMBL2581 | P07339 | Cathepsin D | 99.61% | 98.95% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 98.66% | 98.33% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 98.48% | 98.10% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 97.87% | 96.47% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 97.80% | 93.56% |
| CHEMBL2208 | P49137 | MAP kinase-activated protein kinase 2 | 97.70% | 95.20% |
| CHEMBL2730 | P21980 | Protein-glutamine gamma-glutamyltransferase | 97.58% | 92.38% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 97.34% | 97.09% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.22% | 96.09% |
| CHEMBL4801 | P29466 | Caspase-1 | 97.17% | 96.85% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 97.06% | 100.00% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 96.90% | 94.66% |
| CHEMBL4018 | P49146 | Neuropeptide Y receptor type 2 | 96.28% | 98.94% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 96.20% | 97.64% |
| CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 96.00% | 88.42% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 95.80% | 90.17% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 95.69% | 99.17% |
| CHEMBL4296 | Q15858 | Sodium channel protein type IX alpha subunit | 95.41% | 96.11% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 95.31% | 89.63% |
| CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 94.65% | 98.24% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.48% | 91.11% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 94.31% | 98.05% |
| CHEMBL3024 | P53350 | Serine/threonine-protein kinase PLK1 | 93.80% | 97.43% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 93.69% | 91.19% |
| CHEMBL3468 | P55210 | Caspase-7 | 93.62% | 95.68% |
| CHEMBL4123 | P30989 | Neurotensin receptor 1 | 93.61% | 96.67% |
| CHEMBL4072 | P07858 | Cathepsin B | 93.43% | 93.67% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 93.40% | 90.08% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 93.35% | 97.14% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 93.31% | 95.00% |
| CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 93.04% | 92.32% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 92.93% | 93.10% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.82% | 95.56% |
| CHEMBL1944495 | P28065 | Proteasome subunit beta type-9 | 92.13% | 97.50% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 91.90% | 95.50% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 91.85% | 93.00% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 91.80% | 98.75% |
| CHEMBL4777 | P25929 | Neuropeptide Y receptor type 1 | 91.54% | 96.67% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 91.47% | 100.00% |
| CHEMBL1801 | P00747 | Plasminogen | 90.41% | 92.44% |
| CHEMBL3176 | O43603 | Galanin receptor 2 | 90.11% | 98.89% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 90.08% | 90.71% |
| CHEMBL4618 | P09960 | Leukotriene A4 hydrolase | 89.77% | 97.86% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 89.37% | 96.90% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 89.27% | 82.38% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 88.91% | 95.71% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 88.37% | 100.00% |
| CHEMBL4374 | Q9Y5X4 | Photoreceptor-specific nuclear receptor | 87.69% | 85.00% |
| CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 87.51% | 97.47% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 86.90% | 94.75% |
| CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 86.64% | 96.03% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 86.38% | 94.33% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.13% | 94.45% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 85.92% | 93.18% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 85.80% | 94.45% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 85.29% | 95.38% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 85.28% | 97.25% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 85.11% | 89.50% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 84.67% | 82.69% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 84.34% | 90.20% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 84.18% | 91.81% |
| CHEMBL4330 | Q9NS75 | Cysteinyl leukotriene receptor 2 | 84.09% | 98.00% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 83.81% | 90.24% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 83.72% | 93.03% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.30% | 96.00% |
| CHEMBL1075317 | P61964 | WD repeat-containing protein 5 | 82.98% | 96.33% |
| CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 82.95% | 95.83% |
| CHEMBL206 | P03372 | Estrogen receptor alpha | 82.84% | 97.64% |
| CHEMBL3776 | Q14790 | Caspase-8 | 82.18% | 97.06% |
| CHEMBL321 | P14780 | Matrix metalloproteinase 9 | 81.70% | 92.12% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 81.58% | 88.56% |
| CHEMBL333 | P08253 | Matrix metalloproteinase-2 | 81.20% | 96.31% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 80.92% | 100.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.26% | 95.89% |
| CHEMBL2334 | P42574 | Caspase-3 | 80.25% | 98.25% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163076918 |
| LOTUS | LTS0088930 |
| wikiData | Q104997186 |