Cachimoside
Internal ID | 99665d78-d92b-43d6-89f1-5beb9f6734dc |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid C-glycosides > Flavonoid 8-C-glycosides |
IUPAC Name | 5,7-dihydroxy-2-(4-hydroxyphenyl)-8-[(2S,5S,6S)-3,4,5-trihydroxy-6-[[(2S,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxymethyl]oxan-2-yl]chromen-4-one |
SMILES (Canonical) | C1C(C(C(C(O1)OCC2C(C(C(C(O2)C3=C(C=C(C4=C3OC(=CC4=O)C5=CC=C(C=C5)O)O)O)O)O)O)O)O)O |
SMILES (Isomeric) | C1[C@H]([C@@H](C([C@@H](O1)OC[C@H]2[C@H](C(C([C@@H](O2)C3=C(C=C(C4=C3OC(=CC4=O)C5=CC=C(C=C5)O)O)O)O)O)O)O)O)O |
InChI | InChI=1S/C26H28O14/c27-10-3-1-9(2-4-10)15-6-13(30)17-11(28)5-12(29)18(24(17)39-15)25-22(35)21(34)20(33)16(40-25)8-38-26-23(36)19(32)14(31)7-37-26/h1-6,14,16,19-23,25-29,31-36H,7-8H2/t14-,16+,19+,20-,21?,22?,23?,25+,26+/m1/s1 |
InChI Key | DLIIIVWLAGTXTQ-YMILNDFRSA-N |
Popularity | 0 references in papers |
Molecular Formula | C26H28O14 |
Molecular Weight | 564.50 g/mol |
Exact Mass | 564.14790556 g/mol |
Topological Polar Surface Area (TPSA) | 236.00 Ų |
XlogP | -1.90 |
Kachimoside |
Vitexin 6''-O-xyloside |
LMPK12110205 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.55% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 97.58% | 98.95% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 95.28% | 94.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.34% | 89.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.99% | 97.09% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 91.42% | 99.15% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.67% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.38% | 95.56% |
CHEMBL308 | P06493 | Cyclin-dependent kinase 1 | 88.05% | 91.73% |
CHEMBL1075162 | Q13304 | Uracil nucleotide/cysteinyl leukotriene receptor | 87.13% | 80.33% |
CHEMBL3401 | O75469 | Pregnane X receptor | 87.11% | 94.73% |
CHEMBL5284 | Q96RR4 | CaM-kinase kinase beta | 85.55% | 89.23% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 84.87% | 91.71% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.19% | 94.45% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 82.68% | 91.49% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 82.67% | 86.92% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.62% | 90.71% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 81.10% | 95.83% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.32% | 99.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Gypsophila paniculata |
PubChem | 44257661 |
LOTUS | LTS0276249 |
wikiData | Q104984334 |