2-(3,4-Dihydroxyphenyl)-5-hydroxy-3-methoxy-7-[3,4,5-trihydroxy-6-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxymethyl]oxan-2-yl]oxychromen-4-one
Internal ID | 8bbd96e0-c378-4945-9794-762ae1d073da |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-7-O-glycosides |
IUPAC Name | 2-(3,4-dihydroxyphenyl)-5-hydroxy-3-methoxy-7-[3,4,5-trihydroxy-6-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxymethyl]oxan-2-yl]oxychromen-4-one |
SMILES (Canonical) | CC1C(C(C(C(O1)OCC2C(C(C(C(O2)OC3=CC(=C4C(=C3)OC(=C(C4=O)OC)C5=CC(=C(C=C5)O)O)O)O)O)O)O)O)O |
SMILES (Isomeric) | CC1C(C(C(C(O1)OCC2C(C(C(C(O2)OC3=CC(=C4C(=C3)OC(=C(C4=O)OC)C5=CC(=C(C=C5)O)O)O)O)O)O)O)O)O |
InChI | InChI=1S/C28H32O16/c1-9-18(32)21(35)23(37)27(41-9)40-8-16-19(33)22(36)24(38)28(44-16)42-11-6-14(31)17-15(7-11)43-25(26(39-2)20(17)34)10-3-4-12(29)13(30)5-10/h3-7,9,16,18-19,21-24,27-33,35-38H,8H2,1-2H3 |
InChI Key | PUOSBMABMJBMGX-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C28H32O16 |
Molecular Weight | 624.50 g/mol |
Exact Mass | 624.16903493 g/mol |
Topological Polar Surface Area (TPSA) | 255.00 Ų |
XlogP | -1.00 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.70% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 98.34% | 91.49% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.22% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 96.05% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 96.01% | 98.95% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 95.69% | 94.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 94.32% | 99.15% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.50% | 96.09% |
CHEMBL3401 | O75469 | Pregnane X receptor | 92.19% | 94.73% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.50% | 85.14% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.21% | 99.17% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.23% | 97.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.57% | 95.56% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.46% | 94.45% |
CHEMBL4208 | P20618 | Proteasome component C5 | 82.53% | 90.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.81% | 96.00% |
CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 81.50% | 80.78% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 81.26% | 86.92% |
CHEMBL1907 | P15144 | Aminopeptidase N | 81.10% | 93.31% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Bidens pilosa |
Lepisorus contortus |
PubChem | 78393787 |
LOTUS | LTS0152352 |
wikiData | Q105215185 |