2-(3,4-Dimethoxyphenyl)-5-hydroxy-8-[5-hydroxy-7-methoxy-2-(4-methoxyphenyl)-4-oxo-2,3-dihydrochromen-3-yl]-7-methoxychromen-4-one
| Internal ID | dbd3b224-43bd-495c-ab48-8bd5dc11530e |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Biflavonoids and polyflavonoids |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-5-hydroxy-8-[5-hydroxy-7-methoxy-2-(4-methoxyphenyl)-4-oxo-2,3-dihydrochromen-3-yl]-7-methoxychromen-4-one |
| SMILES (Canonical) | COC1=CC=C(C=C1)C2C(C(=O)C3=C(C=C(C=C3O2)OC)O)C4=C(C=C(C5=C4OC(=CC5=O)C6=CC(=C(C=C6)OC)OC)O)OC |
| SMILES (Isomeric) | COC1=CC=C(C=C1)C2C(C(=O)C3=C(C=C(C=C3O2)OC)O)C4=C(C=C(C5=C4OC(=CC5=O)C6=CC(=C(C=C6)OC)OC)O)OC |
| InChI | InChI=1S/C35H30O11/c1-40-19-9-6-17(7-10-19)34-32(33(39)30-21(36)13-20(41-2)14-28(30)46-34)31-27(44-5)16-23(38)29-22(37)15-25(45-35(29)31)18-8-11-24(42-3)26(12-18)43-4/h6-16,32,34,36,38H,1-5H3 |
| InChI Key | BZEKKSSYFMPCCF-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C35H30O11 |
| Molecular Weight | 626.60 g/mol |
| Exact Mass | 626.17881177 g/mol |
| Topological Polar Surface Area (TPSA) | 139.00 Ų |
| XlogP | 6.10 |
| BDBM50513779 |
![2D Structure of 2-(3,4-Dimethoxyphenyl)-5-hydroxy-8-[5-hydroxy-7-methoxy-2-(4-methoxyphenyl)-4-oxo-2,3-dihydrochromen-3-yl]-7-methoxychromen-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/ca16b560-8550-11ee-ae28-d73c59f0c989.jpg "2D Structure of 2-(3,4-Dimethoxyphenyl)-5-hydroxy-8-[5-hydroxy-7-methoxy-2-(4-methoxyphenyl)-4-oxo-2,3-dihydrochromen-3-yl]-7-methoxychromen-4-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 97.47% | 94.00% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 96.88% | 99.15% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.31% | 91.11% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.72% | 85.14% |
| CHEMBL240 | Q12809 | HERG | 95.53% | 89.76% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.70% | 95.56% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.21% | 89.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.12% | 86.33% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 90.33% | 99.23% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 89.24% | 86.92% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.96% | 99.17% |
| CHEMBL2581 | P07339 | Cathepsin D | 88.69% | 98.95% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 88.39% | 92.94% |
| CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 88.07% | 95.78% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.75% | 97.09% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 87.51% | 93.99% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 87.41% | 90.00% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 87.12% | 96.21% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 84.98% | 97.14% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 84.95% | 96.09% |
| CHEMBL2243 | O00519 | Anandamide amidohydrolase | 83.97% | 97.53% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 83.02% | 93.65% |
| CHEMBL2535 | P11166 | Glucose transporter | 82.68% | 98.75% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 81.64% | 93.31% |
| CHEMBL3194 | P02766 | Transthyretin | 81.64% | 90.71% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 80.33% | 94.73% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.26% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Garcinia gardneriana |
| PubChem | 155514973 |
| LOTUS | LTS0099629 |
| wikiData | Q104950425 |