(8S)-3,8-dihydroxy-16,17-dimethoxy-15-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxytricyclo[12.3.1.12,6]nonadeca-1(17),2,4,6(19),14(18),15-hexaen-9-one
Internal ID | d65dfc6a-3bb2-477c-9410-52a7deedca2b |
Taxonomy | Phenylpropanoids and polyketides > Diarylheptanoids > Cyclic diarylheptanoids > Meta,meta-bridged biphenyls |
IUPAC Name | (8S)-3,8-dihydroxy-16,17-dimethoxy-15-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxytricyclo[12.3.1.12,6]nonadeca-1(17),2,4,6(19),14(18),15-hexaen-9-one |
SMILES (Canonical) | COC1=C2C=C(CCCCC(=O)C(CC3=CC2=C(C=C3)O)O)C(=C1OC)OC4C(C(C(C(O4)CO)O)O)O |
SMILES (Isomeric) | COC1=C2C=C(CCCCC(=O)[C@H](CC3=CC2=C(C=C3)O)O)C(=C1OC)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O |
InChI | InChI=1S/C27H34O11/c1-35-25-16-11-14(5-3-4-6-18(30)19(31)10-13-7-8-17(29)15(16)9-13)24(26(25)36-2)38-27-23(34)22(33)21(32)20(12-28)37-27/h7-9,11,19-23,27-29,31-34H,3-6,10,12H2,1-2H3/t19-,20+,21+,22-,23+,27-/m0/s1 |
InChI Key | BSILZSYJTIBPFN-HDUIEKHKSA-N |
Popularity | 0 references in papers |
Molecular Formula | C27H34O11 |
Molecular Weight | 534.60 g/mol |
Exact Mass | 534.21011190 g/mol |
Topological Polar Surface Area (TPSA) | 175.00 Ų |
XlogP | 1.30 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.58% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 97.34% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.00% | 96.09% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 94.23% | 91.49% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.84% | 95.56% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.78% | 94.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.70% | 86.33% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.24% | 97.09% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.62% | 95.89% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.75% | 89.00% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 87.47% | 95.83% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.52% | 99.17% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.09% | 90.71% |
CHEMBL2535 | P11166 | Glucose transporter | 82.18% | 98.75% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 82.04% | 99.15% |
CHEMBL4208 | P20618 | Proteasome component C5 | 81.60% | 90.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.33% | 94.45% |
CHEMBL4940 | P07195 | L-lactate dehydrogenase B chain | 80.18% | 95.53% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.01% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Myrica gale |
PubChem | 162985690 |
LOTUS | LTS0171137 |
wikiData | Q104945257 |