[(1S,4S,5R,6E,8S,9S,12R)-5-acetyloxy-6,8,9-trimethyl-13-oxatricyclo[6.5.0.01,12]tridec-6-en-4-yl] acetate
| Internal ID | a57b1512-882f-4ae5-95bd-bb0a250c1943 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
| IUPAC Name | [(1S,4S,5R,6E,8S,9S,12R)-5-acetyloxy-6,8,9-trimethyl-13-oxatricyclo[6.5.0.01,12]tridec-6-en-4-yl] acetate |
| SMILES (Canonical) | CC1CCC2C3(C1(C=C(C(C(CC3)OC(=O)C)OC(=O)C)C)C)O2 |
| SMILES (Isomeric) | C[C@H]1CC[C@@H]2[C@]3([C@@]1(/C=C(/[C@H]([C@H](CC3)OC(=O)C)OC(=O)C)\C)C)O2 |
| InChI | InChI=1S/C19H28O5/c1-11-10-18(5)12(2)6-7-16-19(18,24-16)9-8-15(22-13(3)20)17(11)23-14(4)21/h10,12,15-17H,6-9H2,1-5H3/b11-10+/t12-,15-,16+,17+,18+,19+/m0/s1 |
| InChI Key | UPYMCEHJCPVDSR-KUJFETMESA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C19H28O5 |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.19367399 g/mol |
| Topological Polar Surface Area (TPSA) | 65.10 Ų |
| XlogP | 2.60 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.45% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.30% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.14% | 98.95% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.14% | 94.45% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 85.34% | 94.80% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 85.09% | 91.19% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.60% | 100.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.43% | 95.56% |
| CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 81.68% | 97.28% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.07% | 97.09% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.81% | 89.00% |
| CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 80.50% | 94.08% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.25% | 95.89% |
| CHEMBL5028 | O14672 | ADAM10 | 80.02% | 97.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 16742793 |
| LOTUS | LTS0064149 |
| wikiData | Q105277066 |