[2-[[8-Formyl-4-(3-hydroxy-3-methylpent-4-enyl)-3,4a,8-trimethyl-1,4,5,6,7,8a-hexahydronaphthalen-1-yl]oxy]-4,5-dihydroxyoxan-3-yl] acetate
Internal ID | 996e3176-c21e-47c7-a5ab-46f0aea5f06e |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids |
IUPAC Name | [2-[[8-formyl-4-(3-hydroxy-3-methylpent-4-enyl)-3,4a,8-trimethyl-1,4,5,6,7,8a-hexahydronaphthalen-1-yl]oxy]-4,5-dihydroxyoxan-3-yl] acetate |
SMILES (Canonical) | CC1=CC(C2C(CCCC2(C1CCC(C)(C=C)O)C)(C)C=O)OC3C(C(C(CO3)O)O)OC(=O)C |
SMILES (Isomeric) | CC1=CC(C2C(CCCC2(C1CCC(C)(C=C)O)C)(C)C=O)OC3C(C(C(CO3)O)O)OC(=O)C |
InChI | InChI=1S/C27H42O8/c1-7-26(5,32)12-9-18-16(2)13-20(23-25(4,15-28)10-8-11-27(18,23)6)35-24-22(34-17(3)29)21(31)19(30)14-33-24/h7,13,15,18-24,30-32H,1,8-12,14H2,2-6H3 |
InChI Key | JFXTVJUGZGARGJ-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C27H42O8 |
Molecular Weight | 494.60 g/mol |
Exact Mass | 494.28796829 g/mol |
Topological Polar Surface Area (TPSA) | 123.00 Ų |
XlogP | 1.90 |
There are no found synonyms. |
![2D Structure of [2-[[8-Formyl-4-(3-hydroxy-3-methylpent-4-enyl)-3,4a,8-trimethyl-1,4,5,6,7,8a-hexahydronaphthalen-1-yl]oxy]-4,5-dihydroxyoxan-3-yl] acetate 2D Structure of [2-[[8-Formyl-4-(3-hydroxy-3-methylpent-4-enyl)-3,4a,8-trimethyl-1,4,5,6,7,8a-hexahydronaphthalen-1-yl]oxy]-4,5-dihydroxyoxan-3-yl] acetate](https://plantaedb.com/storage/docs/compounds/2023/11/c9d54ec0-864a-11ee-b046-7146bf7590bc.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.56% | 91.11% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.91% | 97.25% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.37% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 92.78% | 98.95% |
CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 90.29% | 90.93% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.70% | 100.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.28% | 94.45% |
CHEMBL5028 | O14672 | ADAM10 | 86.77% | 97.50% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.44% | 86.33% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.37% | 95.89% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.01% | 89.00% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 84.88% | 91.07% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 84.10% | 97.28% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 83.80% | 92.88% |
CHEMBL3401 | O75469 | Pregnane X receptor | 83.77% | 94.73% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.73% | 95.56% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.54% | 97.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Gutierrezia sphaerocephala |
PubChem | 162846822 |
LOTUS | LTS0251761 |
wikiData | Q105127121 |