methyl (2Z)-2-[(1S,13E,18R,19R,21S,22R,23R,24S,26R,28S,29R,30S,33S,36S)-18,24,30-trihydroxy-13,22,29-trimethyl-3,7,10,15,31-pentaoxo-2,6,11,16-tetraoxanonacyclo[16.15.3.125,29.01,23.04,34.019,21.022,36.026,28.033,37]heptatriaconta-4(34),13,25(37)-trien-32-ylidene]propanoate
Internal ID | 48e71970-d0d4-4b04-bd69-79ee405d2333 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | methyl (2Z)-2-[(1S,13E,18R,19R,21S,22R,23R,24S,26R,28S,29R,30S,33S,36S)-18,24,30-trihydroxy-13,22,29-trimethyl-3,7,10,15,31-pentaoxo-2,6,11,16-tetraoxanonacyclo[16.15.3.125,29.01,23.04,34.019,21.022,36.026,28.033,37]heptatriaconta-4(34),13,25(37)-trien-32-ylidene]propanoate |
SMILES (Canonical) | CC1=CC(=O)OCC2(C3CC3C4(C2CC5=C(COC(=O)CCC(=O)OC1)C(=O)OC56C4C(C7=C8C6C(=C(C)C(=O)OC)C(=O)C(C8(C9C7C9)C)O)O)C)O |
SMILES (Isomeric) | C/C/1=C\C(=O)OC[C@]2([C@@H]3C[C@@H]3[C@@]4([C@@H]2CC5=C(COC(=O)CCC(=O)OC1)C(=O)O[C@@]56[C@H]4[C@@H](C7=C8[C@H]6/C(=C(\C)/C(=O)OC)/C(=O)[C@H]([C@@]8([C@@H]9[C@H]7C9)C)O)O)C)O |
InChI | InChI=1S/C40H44O14/c1-15-8-26(43)53-14-39(49)22-10-21(22)37(3)23(39)11-20-18(13-52-25(42)7-6-24(41)51-12-15)36(48)54-40(20)30-27(16(2)35(47)50-5)32(45)34(46)38(4)19-9-17(19)28(29(30)38)31(44)33(37)40/h8,17,19,21-23,30-31,33-34,44,46,49H,6-7,9-14H2,1-5H3/b15-8+,27-16-/t17-,19+,21+,22-,23+,30-,31-,33+,34-,37-,38-,39-,40+/m1/s1 |
InChI Key | XUMNAHFUIBEFRS-GXFNPTDESA-N |
Popularity | 0 references in papers |
Molecular Formula | C40H44O14 |
Molecular Weight | 748.80 g/mol |
Exact Mass | 748.27310607 g/mol |
Topological Polar Surface Area (TPSA) | 209.00 Ų |
XlogP | -0.80 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 99.23% | 85.14% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.76% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.09% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 96.06% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.66% | 95.56% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.43% | 94.45% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 91.72% | 99.23% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 90.05% | 97.14% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.37% | 97.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.08% | 89.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.34% | 100.00% |
CHEMBL5028 | O14672 | ADAM10 | 86.65% | 97.50% |
CHEMBL2243 | O00519 | Anandamide amidohydrolase | 84.84% | 97.53% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 83.48% | 82.69% |
CHEMBL4073 | P09237 | Matrix metalloproteinase 7 | 82.44% | 97.56% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 82.31% | 93.03% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Chloranthus fortunei |
PubChem | 163027046 |
LOTUS | LTS0184603 |
wikiData | Q105342412 |