(3S,8R,9S,10R,13S,14S,17R)-17-[(1S)-1-[(3S,4'R,5'R,5aR,6'R,7S,9R,9aR)-5'-[(2S,4S,5R,6R)-5-[(2S,4R,5S,6R)-4-hydroxy-5-[(2S,4S,5R,6R)-5-[(2S,4R,5R,6R)-5-hydroxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-4'-methoxy-6',9-dimethylspiro[4,5a,6,7,9,9a-hexahydropyrano[3,4-c][1,2,5]trioxepine-3,2'-oxane]-7-yl]oxyethyl]-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,17-diol
Internal ID | 9681c7ab-f613-4d8e-a679-a20dcd8f9d91 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides |
IUPAC Name | (3S,8R,9S,10R,13S,14S,17R)-17-[(1S)-1-[(3S,4'R,5'R,5aR,6'R,7S,9R,9aR)-5'-[(2S,4S,5R,6R)-5-[(2S,4R,5S,6R)-4-hydroxy-5-[(2S,4S,5R,6R)-5-[(2S,4R,5R,6R)-5-hydroxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-4'-methoxy-6',9-dimethylspiro[4,5a,6,7,9,9a-hexahydropyrano[3,4-c][1,2,5]trioxepine-3,2'-oxane]-7-yl]oxyethyl]-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,17-diol |
SMILES (Canonical) | CC1C(C(CC(O1)OC2C(OC(CC2OC)OC3C(OC(CC3O)OC4C(OC(CC4OC)OC5C(OC6(CC5OC)COC7CC(OC(C7OO6)C)OC(C)C8(CCC9C8(CCC1C9CC=C2C1(CCC(C2)O)C)C)O)C)C)C)C)OC)O |
SMILES (Isomeric) | C[C@@H]1[C@H]([C@@H](C[C@@H](O1)O[C@@H]2[C@H](O[C@H](C[C@@H]2OC)O[C@@H]3[C@H](O[C@H](C[C@H]3O)O[C@@H]4[C@H](O[C@H](C[C@@H]4OC)O[C@@H]5[C@H](O[C@]6(C[C@H]5OC)CO[C@@H]7C[C@@H](O[C@@H]([C@H]7OO6)C)O[C@@H](C)[C@]8(CC[C@@H]9[C@@]8(CC[C@H]1[C@H]9CC=C2[C@@]1(CC[C@@H](C2)O)C)C)O)C)C)C)C)OC)O |
InChI | InChI=1S/C62H102O22/c1-30-53(65)43(67-10)24-50(72-30)80-56-33(4)74-51(25-44(56)68-11)78-54-31(2)73-48(23-42(54)64)79-55-32(3)75-52(26-45(55)69-12)81-57-35(6)82-61(28-47(57)70-13)29-71-46-27-49(76-34(5)58(46)83-84-61)77-36(7)62(66)21-18-41-39-15-14-37-22-38(63)16-19-59(37,8)40(39)17-20-60(41,62)9/h14,30-36,38-58,63-66H,15-29H2,1-13H3/t30-,31-,32-,33-,34-,35-,36+,38+,39-,40+,41+,42-,43-,44+,45+,46-,47-,48+,49+,50+,51+,52+,53-,54-,55-,56-,57-,58-,59+,60+,61+,62+/m1/s1 |
InChI Key | QQCQUZGXPCJXCH-YUJYILAWSA-N |
Popularity | 0 references in papers |
Molecular Formula | C62H102O22 |
Molecular Weight | 1199.50 g/mol |
Exact Mass | 1198.68627488 g/mol |
Topological Polar Surface Area (TPSA) | 247.00 Ų |
XlogP | 4.50 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.46% | 91.11% |
CHEMBL1914 | P06276 | Butyrylcholinesterase | 99.33% | 95.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.07% | 96.09% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 98.15% | 95.93% |
CHEMBL204 | P00734 | Thrombin | 97.05% | 96.01% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.28% | 97.25% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.72% | 94.45% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 93.86% | 100.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.72% | 97.09% |
CHEMBL2581 | P07339 | Cathepsin D | 92.19% | 98.95% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.69% | 85.14% |
CHEMBL4072 | P07858 | Cathepsin B | 90.81% | 93.67% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 89.98% | 92.88% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.74% | 95.89% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 89.66% | 95.89% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 89.28% | 97.14% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 89.22% | 89.05% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 88.74% | 97.33% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 88.47% | 91.03% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.00% | 86.33% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 87.96% | 93.40% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.06% | 89.00% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 86.03% | 92.62% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 85.92% | 100.00% |
CHEMBL1871 | P10275 | Androgen Receptor | 85.61% | 96.43% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 85.54% | 91.07% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 85.11% | 92.94% |
CHEMBL2959 | Q08881 | Tyrosine-protein kinase ITK/TSK | 84.24% | 95.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.00% | 95.56% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 83.78% | 93.56% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 82.44% | 100.00% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 81.50% | 92.98% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 81.36% | 95.71% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.22% | 94.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Periploca sepium |
PubChem | 25149301 |
LOTUS | LTS0168427 |
wikiData | Q105225747 |