(2R,3S,4R,5R,6S)-2-[(2R,3S,4R,5S,6S)-2-[(2S,3R,4S,5S,6S)-4,5-dihydroxy-2-(hydroxymethyl)-6-[(1R,2S,4R,5'R,6R,7R,8S,9R,12S,13R,16R,18S)-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-oxane]-16-yl]oxyoxan-3-yl]oxy-5-hydroxy-6-(hydroxymethyl)-4-[(2R,3S,4R,5S)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol
Internal ID | 3e2155e9-27e2-4d1a-bcb3-2e700e475f0c |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
IUPAC Name | (2R,3S,4R,5R,6S)-2-[(2R,3S,4R,5S,6S)-2-[(2S,3R,4S,5S,6S)-4,5-dihydroxy-2-(hydroxymethyl)-6-[(1R,2S,4R,5'R,6R,7R,8S,9R,12S,13R,16R,18S)-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-oxane]-16-yl]oxyoxan-3-yl]oxy-5-hydroxy-6-(hydroxymethyl)-4-[(2R,3S,4R,5S)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
SMILES (Canonical) | CC1CCC2(C(C3C(O2)CC4C3(CCC5C4CCC6C5(CCC(C6)OC7C(C(C(C(O7)CO)OC8C(C(C(C(O8)CO)O)OC9C(C(C(CO9)O)O)O)OC2C(C(C(C(O2)CO)O)O)O)O)O)C)C)C)OC1 |
SMILES (Isomeric) | C[C@@H]1CC[C@@]2([C@@H]([C@@H]3[C@H](O2)C[C@@H]4[C@]3(CC[C@H]5[C@H]4CC[C@@H]6[C@]5(CC[C@H](C6)O[C@@H]7[C@H]([C@@H]([C@H]([C@@H](O7)CO)O[C@@H]8[C@H]([C@@H]([C@H]([C@@H](O8)CO)O)O[C@@H]9[C@H]([C@@H]([C@H](CO9)O)O)O)O[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)CO)O)O)O)O)O)C)C)C)OC1 |
InChI | InChI=1S/C50H82O22/c1-20-7-12-50(64-18-20)21(2)32-28(72-50)14-26-24-6-5-22-13-23(8-10-48(22,3)25(24)9-11-49(26,32)4)65-45-40(62)37(59)41(31(17-53)68-45)69-47-43(71-46-39(61)36(58)34(56)29(15-51)66-46)42(35(57)30(16-52)67-47)70-44-38(60)33(55)27(54)19-63-44/h20-47,51-62H,5-19H2,1-4H3/t20-,21-,22+,23-,24-,25+,26+,27+,28-,29+,30+,31+,32-,33-,34+,35+,36-,37+,38+,39+,40+,41+,42-,43+,44-,45+,46-,47-,48-,49-,50-/m1/s1 |
InChI Key | BJNQXJIQCPPOHN-GSSXFXIZSA-N |
Popularity | 0 references in papers |
Molecular Formula | C50H82O22 |
Molecular Weight | 1035.20 g/mol |
Exact Mass | 1034.52977424 g/mol |
Topological Polar Surface Area (TPSA) | 335.00 Ų |
XlogP | -0.40 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.27% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.83% | 91.11% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.96% | 97.09% |
CHEMBL233 | P35372 | Mu opioid receptor | 95.72% | 97.93% |
CHEMBL237 | P41145 | Kappa opioid receptor | 94.68% | 98.10% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 93.82% | 96.61% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 91.49% | 95.50% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.30% | 94.45% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 91.02% | 100.00% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 90.73% | 95.93% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 90.71% | 96.77% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 90.20% | 97.25% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 89.49% | 95.58% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 88.82% | 92.50% |
CHEMBL4618 | P09960 | Leukotriene A4 hydrolase | 88.41% | 97.86% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 88.39% | 92.86% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 87.31% | 89.05% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 86.59% | 96.21% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 86.36% | 92.94% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 85.60% | 91.24% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 85.51% | 97.29% |
CHEMBL204 | P00734 | Thrombin | 84.80% | 96.01% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 84.74% | 100.00% |
CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 83.98% | 97.50% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.71% | 95.89% |
CHEMBL206 | P03372 | Estrogen receptor alpha | 82.66% | 97.64% |
CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 82.20% | 93.10% |
CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 82.00% | 97.31% |
CHEMBL1075162 | Q13304 | Uracil nucleotide/cysteinyl leukotriene receptor | 81.90% | 80.33% |
CHEMBL5524 | Q99873 | Protein-arginine N-methyltransferase 1 | 81.28% | 96.67% |
CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 81.25% | 100.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.59% | 95.89% |
CHEMBL1907601 | P11802 | Cyclin-dependent kinase 4/cyclin D1 | 80.28% | 98.99% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.26% | 89.00% |
CHEMBL2534 | O15530 | 3-phosphoinositide dependent protein kinase-1 | 80.19% | 95.36% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Dichelostemma multiflorum |
Tribulus terrestris |
PubChem | 163187660 |
LOTUS | LTS0109056 |
wikiData | Q104937194 |