(3S,5R,10S,13R,14S,17R)-3-[(2S,3R,4S,5S)-3-[(2S,3R,4R,5S,6R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4-[(2S,3R,4R,5S)-3,4-dihydroxy-5-[(2S,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-5-hydroxyoxan-2-yl]oxy-4,4,10,13-tetramethyl-17-[(2R)-6-methyl-5-methylideneheptan-2-yl]-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-14-carboxylic acid
| Internal ID | 2c3ad3cc-3cb5-4c5a-bd63-174012736e67 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
| IUPAC Name | (3S,5R,10S,13R,14S,17R)-3-[(2S,3R,4S,5S)-3-[(2S,3R,4R,5S,6R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4-[(2S,3R,4R,5S)-3,4-dihydroxy-5-[(2S,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-5-hydroxyoxan-2-yl]oxy-4,4,10,13-tetramethyl-17-[(2R)-6-methyl-5-methylideneheptan-2-yl]-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-14-carboxylic acid |
| SMILES (Canonical) | CC(C)C(=C)CCC(C)C1CCC2(C1(CCC3=C2CCC4C3(CCC(C4(C)C)OC5C(C(C(CO5)O)OC6C(C(C(CO6)OC7C(C(C(CO7)O)O)O)O)O)OC8C(C(C(C(O8)CO)O)O)NC(=O)C)C)C)C(=O)O |
| SMILES (Isomeric) | C[C@H](CCC(=C)C(C)C)[C@H]1CC[C@@]2([C@@]1(CCC3=C2CC[C@@H]4[C@@]3(CC[C@@H](C4(C)C)O[C@H]5[C@@H]([C@H]([C@H](CO5)O)O[C@H]6[C@@H]([C@H]([C@H](CO6)O[C@H]7[C@@H]([C@H]([C@H](CO7)O)O)O)O)O)O[C@H]8[C@@H]([C@H]([C@@H]([C@H](O8)CO)O)O)NC(=O)C)C)C)C(=O)O |
| InChI | InChI=1S/C54H87NO20/c1-24(2)25(3)10-11-26(4)28-15-19-54(50(66)67)30-12-13-35-51(6,7)36(16-17-52(35,8)29(30)14-18-53(28,54)9)73-49-45(75-46-37(55-27(5)57)41(63)39(61)33(20-56)71-46)44(32(59)22-69-49)74-48-43(65)40(62)34(23-70-48)72-47-42(64)38(60)31(58)21-68-47/h24,26,28,31-49,56,58-65H,3,10-23H2,1-2,4-9H3,(H,55,57)(H,66,67)/t26-,28-,31+,32+,33-,34+,35+,36+,37-,38+,39-,40+,41-,42-,43-,44+,45-,46+,47+,48+,49+,52-,53-,54+/m1/s1 |
| InChI Key | MVPBHQIYWHNLGO-VHQJFFKESA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C54H87NO20 |
| Molecular Weight | 1070.30 g/mol |
| Exact Mass | 1069.58214416 g/mol |
| Topological Polar Surface Area (TPSA) | 322.00 Ų |
| XlogP | 1.80 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.44% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 97.99% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.53% | 96.09% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 97.21% | 95.17% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 96.91% | 83.82% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.91% | 94.45% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 91.86% | 91.24% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.83% | 99.17% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 90.56% | 90.17% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 90.48% | 95.50% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 90.16% | 95.89% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 89.81% | 94.33% |
| CHEMBL2842 | P42345 | Serine/threonine-protein kinase mTOR | 89.41% | 92.78% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.25% | 89.00% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 88.31% | 95.71% |
| CHEMBL5028 | O14672 | ADAM10 | 87.88% | 97.50% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 87.67% | 96.61% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 87.28% | 96.47% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 87.10% | 91.19% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.74% | 97.09% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 85.11% | 92.50% |
| CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 85.05% | 95.83% |
| CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 84.79% | 82.50% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 84.44% | 97.14% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 84.24% | 92.62% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 84.06% | 95.38% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 83.67% | 97.36% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 83.66% | 100.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.61% | 99.23% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 83.34% | 95.50% |
| CHEMBL2534 | O15530 | 3-phosphoinositide dependent protein kinase-1 | 82.06% | 95.36% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.06% | 90.71% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 81.52% | 96.90% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.35% | 95.89% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 81.27% | 93.00% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 80.45% | 93.56% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 80.32% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 16109771 |
| LOTUS | LTS0135213 |
| wikiData | Q105173218 |