(2S,3R,4R,5R,6S)-2-[(2S,3R,4S,5S,6R)-5-hydroxy-6-(hydroxymethyl)-4-[(1S,2R,3'S,4S,5'R,6S,7S,8R,9S,12R,13R,16S)-3'-hydroxy-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-piperidine]-16-yl]oxy-2-[(2R,3R,4S,5R,6R)-2,3,5-trihydroxy-6-(hydroxymethyl)oxan-4-yl]oxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol
Internal ID | 42b6275a-5ced-4ee5-a18c-2bf7ee92c6fd |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
IUPAC Name | (2S,3R,4R,5R,6S)-2-[(2S,3R,4S,5S,6R)-5-hydroxy-6-(hydroxymethyl)-4-[(1S,2R,3'S,4S,5'R,6S,7S,8R,9S,12R,13R,16S)-3'-hydroxy-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-piperidine]-16-yl]oxy-2-[(2R,3R,4S,5R,6R)-2,3,5-trihydroxy-6-(hydroxymethyl)oxan-4-yl]oxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol |
SMILES (Canonical) | CC1CC(C2(C(C3C(O2)CC4C3(CCC5C4CC=C6C5(CCC(C6)OC7C(C(OC(C7OC8C(C(C(C(O8)C)O)O)O)OC9C(C(OC(C9O)O)CO)O)CO)O)C)C)C)NC1)O |
SMILES (Isomeric) | C[C@@H]1C[C@@H]([C@@]2([C@H]([C@H]3[C@@H](O2)C[C@H]4[C@@]3(CC[C@@H]5[C@H]4CC=C6[C@@]5(CC[C@@H](C6)O[C@H]7[C@H]([C@H](O[C@H]([C@@H]7O[C@H]8[C@@H]([C@@H]([C@H]([C@@H](O8)C)O)O)O)O[C@H]9[C@@H]([C@H](O[C@H]([C@@H]9O)O)CO)O)CO)O)C)C)C)NC1)O |
InChI | InChI=1S/C45H73NO17/c1-18-12-29(49)45(46-15-18)19(2)30-26(63-45)14-25-23-7-6-21-13-22(8-10-43(21,4)24(23)9-11-44(25,30)5)58-38-33(52)28(17-48)60-42(61-37-32(51)27(16-47)59-40(56)36(37)55)39(38)62-41-35(54)34(53)31(50)20(3)57-41/h6,18-20,22-42,46-56H,7-17H2,1-5H3/t18-,19+,20+,22+,23-,24-,25-,26+,27-,28-,29+,30+,31+,32-,33+,34-,35-,36-,37+,38+,39-,40-,41+,42+,43+,44+,45+/m1/s1 |
InChI Key | KJVDNNABEWYEDX-ZYGLDPJQSA-N |
Popularity | 0 references in papers |
Molecular Formula | C45H73NO17 |
Molecular Weight | 900.10 g/mol |
Exact Mass | 899.48784986 g/mol |
Topological Polar Surface Area (TPSA) | 279.00 Ų |
XlogP | 0.10 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.98% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.26% | 91.11% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 97.47% | 95.93% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.90% | 97.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.65% | 94.45% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 93.89% | 100.00% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 89.59% | 89.05% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.10% | 86.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.50% | 89.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.44% | 95.89% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.25% | 94.00% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 88.14% | 92.94% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 86.94% | 95.89% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 85.51% | 97.25% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 84.25% | 96.61% |
CHEMBL2581 | P07339 | Cathepsin D | 83.45% | 98.95% |
CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 83.28% | 94.23% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 82.82% | 94.75% |
CHEMBL237 | P41145 | Kappa opioid receptor | 82.66% | 98.10% |
CHEMBL233 | P35372 | Mu opioid receptor | 82.52% | 97.93% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 80.99% | 93.56% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 80.39% | 91.24% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Solanum donianum |
PubChem | 162987409 |
LOTUS | LTS0154790 |
wikiData | Q105195607 |