[6-[4,5-Dihydroxy-3-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-2-yl]oxy-15-[6-hydroxy-6-methyl-5-(3,4,5-trihydroxyoxan-2-yl)oxyheptan-2-yl]-7,7,12,16-tetramethyl-9-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-14-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl] acetate
| Internal ID | f59fbf4e-8539-4984-b4d5-d54eafeb27b5 |
| Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins > Cucurbitacin glycosides |
| IUPAC Name | [6-[4,5-dihydroxy-3-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-2-yl]oxy-15-[6-hydroxy-6-methyl-5-(3,4,5-trihydroxyoxan-2-yl)oxyheptan-2-yl]-7,7,12,16-tetramethyl-9-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-14-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl] acetate |
| SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(C(COC2OC3CCC45CC46CCC7(C(C(CC7(C6CC(C5C3(C)C)OC8C(C(C(C(O8)CO)O)O)O)C)OC(=O)C)C(C)CCC(C(C)(C)O)OC9C(C(C(CO9)O)O)O)C)O)O)O)O)O |
| SMILES (Isomeric) | CC1C(C(C(C(O1)OC2C(C(COC2OC3CCC45CC46CCC7(C(C(CC7(C6CC(C5C3(C)C)OC8C(C(C(C(O8)CO)O)O)O)C)OC(=O)C)C(C)CCC(C(C)(C)O)OC9C(C(C(CO9)O)O)O)C)O)O)O)O)O |
| InChI | InChI=1S/C54H90O23/c1-22(10-11-32(50(6,7)68)76-45-40(65)35(60)25(57)19-69-45)33-28(72-24(3)56)17-52(9)30-16-27(73-47-42(67)39(64)37(62)29(18-55)74-47)44-49(4,5)31(12-13-54(44)21-53(30,54)15-14-51(33,52)8)75-48-43(36(61)26(58)20-70-48)77-46-41(66)38(63)34(59)23(2)71-46/h22-23,25-48,55,57-68H,10-21H2,1-9H3 |
| InChI Key | KMMHNRHMUQTCPQ-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C54H90O23 |
| Molecular Weight | 1107.30 g/mol |
| Exact Mass | 1106.58728911 g/mol |
| Topological Polar Surface Area (TPSA) | 363.00 Ų |
| XlogP | -0.60 |
| Atomic LogP (AlogP) | -1.55 |
| H-Bond Acceptor | 23 |
| H-Bond Donor | 13 |
| Rotatable Bonds | 15 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.6078 | 60.78% |
| Caco-2 | - | 0.8872 | 88.72% |
| Blood Brain Barrier | - | 0.6250 | 62.50% |
| Human oral bioavailability | - | 0.7857 | 78.57% |
| Subcellular localzation | Mitochondria | 0.6939 | 69.39% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.8185 | 81.85% |
| OATP1B3 inhibitior | + | 0.8998 | 89.98% |
| MATE1 inhibitior | - | 1.0000 | 100.00% |
| OCT2 inhibitior | - | 0.6500 | 65.00% |
| BSEP inhibitior | + | 0.8191 | 81.91% |
| P-glycoprotein inhibitior | + | 0.7555 | 75.55% |
| P-glycoprotein substrate | + | 0.6797 | 67.97% |
| CYP3A4 substrate | + | 0.7436 | 74.36% |
| CYP2C9 substrate | - | 1.0000 | 100.00% |
| CYP2D6 substrate | - | 0.8804 | 88.04% |
| CYP3A4 inhibition | - | 0.9251 | 92.51% |
| CYP2C9 inhibition | - | 0.7950 | 79.50% |
| CYP2C19 inhibition | - | 0.8502 | 85.02% |
| CYP2D6 inhibition | - | 0.9519 | 95.19% |
| CYP1A2 inhibition | - | 0.8924 | 89.24% |
| CYP2C8 inhibition | + | 0.7209 | 72.09% |
| CYP inhibitory promiscuity | - | 0.9717 | 97.17% |
| UGT catelyzed | + | 0.8000 | 80.00% |
| Carcinogenicity (binary) | - | 0.9900 | 99.00% |
| Carcinogenicity (trinary) | Non-required | 0.6989 | 69.89% |
| Eye corrosion | - | 0.9902 | 99.02% |
| Eye irritation | - | 0.9023 | 90.23% |
| Skin irritation | - | 0.6948 | 69.48% |
| Skin corrosion | - | 0.9469 | 94.69% |
| Ames mutagenesis | - | 0.5648 | 56.48% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.7532 | 75.32% |
| Micronuclear | - | 0.8000 | 80.00% |
| Hepatotoxicity | - | 0.7153 | 71.53% |
| skin sensitisation | - | 0.9134 | 91.34% |
| Respiratory toxicity | - | 0.5333 | 53.33% |
| Reproductive toxicity | + | 0.7667 | 76.67% |
| Mitochondrial toxicity | - | 0.5500 | 55.00% |
| Nephrotoxicity | - | 0.8737 | 87.37% |
| Acute Oral Toxicity (c) | I | 0.5431 | 54.31% |
| Estrogen receptor binding | + | 0.7861 | 78.61% |
| Androgen receptor binding | + | 0.7419 | 74.19% |
| Thyroid receptor binding | + | 0.5278 | 52.78% |
| Glucocorticoid receptor binding | + | 0.7519 | 75.19% |
| Aromatase binding | + | 0.6463 | 64.63% |
| PPAR gamma | + | 0.8052 | 80.52% |
| Honey bee toxicity | - | 0.5675 | 56.75% |
| Biodegradation | - | 0.7750 | 77.50% |
| Crustacea aquatic toxicity | - | 0.5300 | 53.00% |
| Fish aquatic toxicity | + | 0.8557 | 85.57% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 99.45% | 97.25% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.86% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.50% | 96.09% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 94.77% | 91.24% |
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 93.99% | 95.58% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.60% | 98.95% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.59% | 97.09% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 91.56% | 98.75% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 90.93% | 96.47% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.11% | 89.00% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 89.99% | 96.61% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 89.33% | 95.93% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 89.08% | 91.19% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 88.88% | 96.77% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 88.80% | 97.79% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.62% | 86.33% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 88.58% | 92.88% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 88.05% | 100.00% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 87.93% | 91.07% |
| CHEMBL2095194 | P08709 | Coagulation factor VII/tissue factor | 86.97% | 99.17% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.76% | 94.45% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 86.52% | 97.36% |
| CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 86.37% | 100.00% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 86.31% | 95.71% |
| CHEMBL2842 | P42345 | Serine/threonine-protein kinase mTOR | 86.04% | 92.78% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 85.98% | 89.50% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 85.83% | 98.10% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.74% | 100.00% |
| CHEMBL4105786 | P41182 | B-cell lymphoma 6 protein | 85.62% | 92.86% |
| CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 85.05% | 82.50% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 84.61% | 97.14% |
| CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 83.90% | 95.71% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 83.89% | 92.94% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 83.29% | 97.29% |
| CHEMBL4618 | P09960 | Leukotriene A4 hydrolase | 82.90% | 97.86% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.87% | 95.89% |
| CHEMBL284 | P27487 | Dipeptidyl peptidase IV | 82.86% | 95.69% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 82.78% | 100.00% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 82.73% | 94.75% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 82.73% | 90.24% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 82.51% | 96.21% |
| CHEMBL5028 | O14672 | ADAM10 | 82.16% | 97.50% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.70% | 96.00% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 81.67% | 94.33% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 81.64% | 95.38% |
| CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 81.38% | 97.47% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 80.54% | 95.50% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 80.37% | 96.95% |
| CHEMBL2007625 | O75874 | Isocitrate dehydrogenase [NADP] cytoplasmic | 80.32% | 99.00% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 80.14% | 91.03% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.09% | 95.89% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 80.05% | 93.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Astragalus condensatus |
| PubChem | 162860768 |
| LOTUS | LTS0170770 |
| wikiData | Q105143038 |