[8a-(hydroxymethyl)-4,6a,6b,12,14b-pentamethyl-11-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-3-(3,4,5-trihydroxyoxan-2-yl)oxy-2,3,4a,5,6,6a,7,8,9,12,12a,13,14,14a-tetradecahydro-1H-picen-4-yl]methyl hydrogen sulfate
Internal ID | 918c2cbc-f316-4c64-93c0-950265cf8d3d |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Triterpene glycosides > Triterpene saponins |
IUPAC Name | [8a-(hydroxymethyl)-4,6a,6b,12,14b-pentamethyl-11-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-3-(3,4,5-trihydroxyoxan-2-yl)oxy-2,3,4a,5,6,6a,7,8,9,12,12a,13,14,14a-tetradecahydro-1H-picen-4-yl]methyl hydrogen sulfate |
SMILES (Canonical) | CC1C2C3CCC4C5(CCC(C(C5CCC4(C3(CCC2(CC=C1COC6C(C(C(C(O6)CO)O)O)O)CO)C)C)(C)COS(=O)(=O)O)OC7C(C(C(CO7)O)O)O)C |
SMILES (Isomeric) | CC1C2C3CCC4C5(CCC(C(C5CCC4(C3(CCC2(CC=C1COC6C(C(C(C(O6)CO)O)O)O)CO)C)C)(C)COS(=O)(=O)O)OC7C(C(C(CO7)O)O)O)C |
InChI | InChI=1S/C41H68O16S/c1-21-22(17-53-35-34(49)32(47)31(46)25(16-42)56-35)8-13-41(19-43)15-14-39(4)23(29(21)41)6-7-27-37(2)11-10-28(57-36-33(48)30(45)24(44)18-54-36)38(3,20-55-58(50,51)52)26(37)9-12-40(27,39)5/h8,21,23-36,42-49H,6-7,9-20H2,1-5H3,(H,50,51,52) |
InChI Key | RBHJQJQPNRFRHI-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C41H68O16S |
Molecular Weight | 849.00 g/mol |
Exact Mass | 848.42280725 g/mol |
Topological Polar Surface Area (TPSA) | 271.00 Ų |
XlogP | 1.50 |
There are no found synonyms. |
![2D Structure of [8a-(hydroxymethyl)-4,6a,6b,12,14b-pentamethyl-11-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-3-(3,4,5-trihydroxyoxan-2-yl)oxy-2,3,4a,5,6,6a,7,8,9,12,12a,13,14,14a-tetradecahydro-1H-picen-4-yl]methyl hydrogen sulfate 2D Structure of [8a-(hydroxymethyl)-4,6a,6b,12,14b-pentamethyl-11-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-3-(3,4,5-trihydroxyoxan-2-yl)oxy-2,3,4a,5,6,6a,7,8,9,12,12a,13,14,14a-tetradecahydro-1H-picen-4-yl]methyl hydrogen sulfate](https://plantaedb.com/storage/docs/compounds/2023/11/c8a63430-84dd-11ee-8512-038abc9f70fe.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.64% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.68% | 95.56% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 93.11% | 96.61% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 92.50% | 92.94% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.42% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.43% | 94.45% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 91.14% | 100.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.30% | 97.09% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.23% | 94.00% |
CHEMBL2581 | P07339 | Cathepsin D | 89.27% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.09% | 86.33% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.44% | 95.89% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 87.15% | 92.88% |
CHEMBL2243 | O00519 | Anandamide amidohydrolase | 86.69% | 97.53% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 85.79% | 95.83% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 85.57% | 95.50% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 84.94% | 94.75% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 83.90% | 97.25% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 83.82% | 97.14% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 82.13% | 86.92% |
CHEMBL2959 | Q08881 | Tyrosine-protein kinase ITK/TSK | 81.68% | 95.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 80.88% | 94.73% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 80.73% | 91.24% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.56% | 89.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.37% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Zygophyllum fabago |
PubChem | 74929107 |
LOTUS | LTS0164839 |
wikiData | Q105233124 |