[8,8-Dimethyl-9-(2-methylbut-2-enoyloxy)-2-oxo-9,10-dihydropyrano[2,3-f]chromen-10-yl] 2-methylbut-2-enoate
Internal ID | 98a7cb78-9449-4035-9a5a-d3b4ccc4343d |
Taxonomy | Phenylpropanoids and polyketides > Coumarins and derivatives > Pyranocoumarins > Angular pyranocoumarins |
IUPAC Name | [8,8-dimethyl-9-(2-methylbut-2-enoyloxy)-2-oxo-9,10-dihydropyrano[2,3-f]chromen-10-yl] 2-methylbut-2-enoate |
SMILES (Canonical) | CC=C(C)C(=O)OC1C(C(OC2=C1C3=C(C=C2)C=CC(=O)O3)(C)C)OC(=O)C(=CC)C |
SMILES (Isomeric) | CC=C(C)C(=O)OC1C(C(OC2=C1C3=C(C=C2)C=CC(=O)O3)(C)C)OC(=O)C(=CC)C |
InChI | InChI=1S/C24H26O7/c1-7-13(3)22(26)29-20-18-16(11-9-15-10-12-17(25)28-19(15)18)31-24(5,6)21(20)30-23(27)14(4)8-2/h7-12,20-21H,1-6H3 |
InChI Key | PNTWXEIQXBRCPS-UHFFFAOYSA-N |
Popularity | 19 references in papers |
Molecular Formula | C24H26O7 |
Molecular Weight | 426.50 g/mol |
Exact Mass | 426.16785316 g/mol |
Topological Polar Surface Area (TPSA) | 88.10 Ų |
XlogP | 4.30 |
Praeruptorin D |
[8,8-dimethyl-9-(2-methylbut-2-enoyloxy)-2-oxo-9,10-dihydropyrano[2,3-f]chromen-10-yl] 2-methylbut-2-enoate |
4970-26-7 |
(-)-Praeruptorin B |
73069-28-0 |
[(9R,10R)-8,8-dimethyl-9-[(Z)-2-methylbut-2-enoyl]oxy-2-oxo-9,10-dihydropyrano[2,3-f]chromen-10-yl] (Z)-2-methylbut-2-enoate |
[(9S,10S)-8,8-dimethyl-9-[(Z)-2-methylbut-2-enoyl]oxy-2-oxo-9,10-dihydropyrano[2,3-f]chromen-10-yl] (Z)-2-methylbut-2-enoate |
FT-0699023 |
FT-0776160 |
(2Z,2'Z)-(9S,10S)-8,8-Dimethyl-2-oxo-2,8,9,10-tetrahydropyrano[2,3-f]chromene-9,10-diyl bis(2-methylbut-2-enoate) |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL1293224 | P10636 | Microtubule-associated protein tau |
501.2 nM |
Potency |
via Super-PRED
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.39% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.45% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 94.94% | 98.95% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.40% | 99.23% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.64% | 95.56% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.21% | 94.00% |
CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 86.12% | 85.30% |
CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 84.94% | 81.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 82.04% | 96.09% |
CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 81.98% | 89.67% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.72% | 86.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.47% | 89.00% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 80.91% | 94.75% |
CHEMBL4145 | Q9UKV0 | Histone deacetylase 9 | 80.50% | 85.49% |
CHEMBL3401 | O75469 | Pregnane X receptor | 80.35% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Angelica adzharica |
Angelica anomala |
Angelica cincta |
Kitagawia praeruptora |
Musineon divaricatum |
Peucedanum austriacum |
Peucedanum japonicum |
PubChem | 163334 |
LOTUS | LTS0118431 |
wikiData | Q105212186 |