(2R,6R)-6-[[(3S,8R,9S,10R,13S,14S,17R)-17-hydroxy-17-[(1R)-1-[(2S,4R,5R,6R)-5-hydroxy-4-(methoxymethoxy)-6-methyloxan-2-yl]oxyethyl]-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl]oxy]-4-methoxy-2-methyl-2H-pyran-5-one
Internal ID | 6192a82f-77c5-48ff-8343-de39c9ccc80e |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides |
IUPAC Name | (2R,6R)-6-[[(3S,8R,9S,10R,13S,14S,17R)-17-hydroxy-17-[(1R)-1-[(2S,4R,5R,6R)-5-hydroxy-4-(methoxymethoxy)-6-methyloxan-2-yl]oxyethyl]-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl]oxy]-4-methoxy-2-methyl-2H-pyran-5-one |
SMILES (Canonical) | CC1C=C(C(=O)C(O1)OC2CCC3(C4CCC5(C(C4CC=C3C2)CCC5(C(C)OC6CC(C(C(O6)C)O)OCOC)O)C)C)OC |
SMILES (Isomeric) | C[C@@H]1C=C(C(=O)[C@@H](O1)O[C@H]2CC[C@@]3([C@H]4CC[C@]5([C@H]([C@@H]4CC=C3C2)CC[C@@]5([C@@H](C)O[C@H]6C[C@H]([C@@H]([C@H](O6)C)O)OCOC)O)C)C)OC |
InChI | InChI=1S/C36H56O10/c1-20-16-28(41-7)32(38)33(43-20)46-24-10-13-34(4)23(17-24)8-9-25-26(34)11-14-35(5)27(25)12-15-36(35,39)22(3)45-30-18-29(42-19-40-6)31(37)21(2)44-30/h8,16,20-22,24-27,29-31,33,37,39H,9-15,17-19H2,1-7H3/t20-,21-,22-,24+,25-,26+,27+,29-,30+,31-,33+,34+,35+,36+/m1/s1 |
InChI Key | OPDVJOHDZLWTNG-LSYDBPMHSA-N |
Popularity | 0 references in papers |
Molecular Formula | C36H56O10 |
Molecular Weight | 648.80 g/mol |
Exact Mass | 648.38734798 g/mol |
Topological Polar Surface Area (TPSA) | 122.00 Ų |
XlogP | 4.30 |
There are no found synonyms. |
![2D Structure of (2R,6R)-6-[[(3S,8R,9S,10R,13S,14S,17R)-17-hydroxy-17-[(1R)-1-[(2S,4R,5R,6R)-5-hydroxy-4-(methoxymethoxy)-6-methyloxan-2-yl]oxyethyl]-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl]oxy]-4-methoxy-2-methyl-2H-pyran-5-one 2D Structure of (2R,6R)-6-[[(3S,8R,9S,10R,13S,14S,17R)-17-hydroxy-17-[(1R)-1-[(2S,4R,5R,6R)-5-hydroxy-4-(methoxymethoxy)-6-methyloxan-2-yl]oxyethyl]-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl]oxy]-4-methoxy-2-methyl-2H-pyran-5-one](https://plantaedb.com/storage/docs/compounds/2023/11/c8746590-8628-11ee-8d42-cdc3c10f5be9.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.23% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.56% | 91.11% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.30% | 97.25% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 93.69% | 95.93% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 93.52% | 95.89% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 93.01% | 95.89% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.15% | 97.09% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 91.55% | 100.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.29% | 86.33% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.16% | 85.14% |
CHEMBL2581 | P07339 | Cathepsin D | 90.60% | 98.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.25% | 94.45% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 88.94% | 97.14% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 88.82% | 96.38% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 88.66% | 96.77% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.62% | 94.00% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 87.76% | 91.07% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 87.73% | 93.40% |
CHEMBL1871 | P10275 | Androgen Receptor | 87.67% | 96.43% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 87.39% | 97.33% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 87.13% | 90.71% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.06% | 89.00% |
CHEMBL1914 | P06276 | Butyrylcholinesterase | 82.34% | 95.00% |
CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 82.00% | 94.23% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.17% | 95.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Periploca sepium |
PubChem | 162945917 |
LOTUS | LTS0264587 |
wikiData | Q105196010 |